{"diffoscope-json-version": 1, "source1": "/srv/reproducible-results/rbuild-debian/r-b-build.5gTMdEMB/b1/libdc1394_2.2.6-4_amd64.changes", "source2": "/srv/reproducible-results/rbuild-debian/r-b-build.5gTMdEMB/b2/libdc1394_2.2.6-4_amd64.changes", "unified_diff": null, "details": [{"source1": "Files", "source2": "Files", "unified_diff": "@@ -1,7 +1,7 @@\n \n  02a36aafd2aee248474c591f25b7cf35 229100 debug optional libdc1394-25-dbgsym_2.2.6-4_amd64.deb\n  e1b2334e1d3f11c8069cccbae1223c3a 110136 libs optional libdc1394-25_2.2.6-4_amd64.deb\n  8d9a913688b0ef79af52721f02c2eaee 135704 libdevel optional libdc1394-dev_2.2.6-4_amd64.deb\n- 982ba6d5ee5a93ccb2ebc440bd9c9a7f 455300 doc optional libdc1394-doc_2.2.6-4_all.deb\n+ 12b8d0d24edac35beac508305145e1dc 455064 doc optional libdc1394-doc_2.2.6-4_all.deb\n  274cd5263e2d1b1950d29f0dd89a61f1 5772 debug optional libdc1394-utils-dbgsym_2.2.6-4_amd64.deb\n  372261aec588e236929f51c79b7a4e69 31988 utils optional libdc1394-utils_2.2.6-4_amd64.deb\n"}, {"source1": "libdc1394-doc_2.2.6-4_all.deb", "source2": "libdc1394-doc_2.2.6-4_all.deb", "unified_diff": null, "details": [{"source1": "file list", "source2": "file list", "unified_diff": "@@ -1,3 +1,3 @@\n -rw-r--r--   0        0        0        4 2021-08-10 20:53:45.000000 debian-binary\n -rw-r--r--   0        0        0     4572 2021-08-10 20:53:45.000000 control.tar.xz\n--rw-r--r--   0        0        0   450536 2021-08-10 20:53:45.000000 data.tar.xz\n+-rw-r--r--   0        0        0   450300 2021-08-10 20:53:45.000000 data.tar.xz\n"}, {"source1": "control.tar.xz", "source2": "control.tar.xz", "unified_diff": null, "details": [{"source1": "control.tar", "source2": "control.tar", "unified_diff": null, "details": [{"source1": "./md5sums", "source2": "./md5sums", "unified_diff": null, "details": [{"source1": "./md5sums", "source2": "./md5sums", "comments": ["Files differ"], "unified_diff": null}]}]}]}, {"source1": "data.tar.xz", "source2": "data.tar.xz", "unified_diff": null, "details": [{"source1": "data.tar", "source2": "data.tar", "unified_diff": null, "details": [{"source1": "file list", "source2": "file list", "unified_diff": "@@ -145,10 +145,10 @@\n -rw-r--r--   0 root         (0) root         (0)      184 2021-08-10 20:53:45.000000 ./usr/share/doc/libdc1394-doc/html/tab_s.png\n -rw-r--r--   0 root         (0) root         (0)      188 2021-08-10 20:53:45.000000 ./usr/share/doc/libdc1394-doc/html/tab_sd.png\n -rw-r--r--   0 root         (0) root         (0)    10560 2021-08-10 20:53:45.000000 ./usr/share/doc/libdc1394-doc/html/tabs.css\n -rw-r--r--   0 root         (0) root         (0)     9872 2021-08-10 20:53:45.000000 ./usr/share/doc/libdc1394-doc/html/types_8h.html\n -rw-r--r--   0 root         (0) root         (0)     3282 2021-08-10 20:53:45.000000 ./usr/share/doc/libdc1394-doc/html/unionfw__cdev__event.html\n -rw-r--r--   0 root         (0) root         (0)    23756 2021-08-10 20:53:45.000000 ./usr/share/doc/libdc1394-doc/html/utils_8h.html\n -rw-r--r--   0 root         (0) root         (0)    47788 2021-08-10 20:53:45.000000 ./usr/share/doc/libdc1394-doc/html/video_8h.html\n--rw-r--r--   0 root         (0) root         (0)   279965 2021-08-10 20:53:45.000000 ./usr/share/doc/libdc1394-doc/libdc1394.pdf.gz\n+-rw-r--r--   0 root         (0) root         (0)   279732 2021-08-10 20:53:45.000000 ./usr/share/doc/libdc1394-doc/libdc1394.pdf.gz\n drwxr-xr-x   0 root         (0) root         (0)        0 2021-08-10 20:53:45.000000 ./usr/share/doc-base/\n -rw-r--r--   0 root         (0) root         (0)      378 2020-09-22 20:24:57.000000 ./usr/share/doc-base/libdc1394-doc.libdc1394-doc\n"}, {"source1": "./usr/share/doc/libdc1394-doc/libdc1394.pdf.gz", "source2": "./usr/share/doc/libdc1394-doc/libdc1394.pdf.gz", "unified_diff": null, "details": [{"source1": "libdc1394.pdf", "source2": "libdc1394.pdf", "unified_diff": null, "details": [{"source1": "pdftotext {} -", "source2": "pdftotext {} -", "unified_diff": "@@ -551,591 +551,590 @@\n \n 28\n \n 4.1.4.12 dc1394_reset_bus() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 29\n \n-4.2 dc1394/control.h File Reference . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.2 dc1394/capture.h File Reference . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 29\n \n 4.2.1 Detailed Description . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-31\n+30\n \n-4.2.2 Typedef Documentation . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.2.2 Macro Definition Documentation\n \n-31\n+. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-4.2.2.1 dc1394feature_info_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+30\n \n-31\n+4.2.2.1 DC1394_CAPTURE_FLAGS_CHANNEL_ALLOC . . . . . . . . . . . . . . . . . .\n \n-4.2.2.2 dc1394featureset_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+30\n \n-32\n+4.2.3 Typedef Documentation . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-4.2.3 Enumeration Type Documentation\n+30\n \n-. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.2.3.1 dc1394capture_callback_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-32\n+30\n \n-4.2.3.1 dc1394feature_mode_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.2.4 Enumeration Type Documentation\n \n-32\n+. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-4.2.3.2 dc1394feature_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+30\n \n-32\n+4.2.4.1 dc1394capture_policy_t\n \n-4.2.3.3 dc1394trigger_mode_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-32\n+30\n \n-4.2.3.4 dc1394trigger_polarity_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-32\n+30\n \n-4.2.3.5 dc1394trigger_source_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.2.5 Function Documentation\n \n-32\n+4.2.5.1 dc1394_capture_dequeue()\n \n-4.2.4 Function Documentation\n+. . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+30\n \n-4.2.4.1 dc1394_camera_reset()\n+4.2.5.2 dc1394_capture_enqueue()\n \n-32\n+. . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+31\n \n-32\n+4.2.5.3 dc1394_capture_get_fileno() . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-4.2.4.2 dc1394_camera_set_power() . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+31\n \n-33\n+4.2.5.4 dc1394_capture_is_frame_corrupt() . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-4.2.4.3 dc1394_external_trigger_get_mode()\n+31\n \n-. . . . . . . . . . . . . . . . . . . . . . . .\n+4.2.5.5 dc1394_capture_set_callback() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-33\n+31\n \n-4.2.4.4 dc1394_external_trigger_get_polarity() . . . . . . . . . . . . . . . . . . . . . . . .\n+4.2.5.6 dc1394_capture_setup() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-33\n+31\n \n-4.2.4.5 dc1394_external_trigger_get_power() . . . . . . . . . . . . . . . . . . . . . . . .\n+4.2.5.7 dc1394_capture_stop() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-33\n+31\n \n-4.2.4.6 dc1394_external_trigger_get_source() . . . . . . . . . . . . . . . . . . . . . . . .\n+4.3 dc1394/control.h File Reference . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-33\n+32\n \n-4.2.4.7 dc1394_external_trigger_get_supported_sources() . . . . . . . . . . . . . . . . .\n+4.3.1 Detailed Description . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-33\n+34\n \n-4.2.4.8 dc1394_external_trigger_has_polarity() . . . . . . . . . . . . . . . . . . . . . . .\n+4.3.2 Typedef Documentation . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 34\n \n-4.2.4.9 dc1394_external_trigger_set_mode()\n-\n-. . . . . . . . . . . . . . . . . . . . . . . .\n+4.3.2.1 dc1394feature_info_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 34\n \n-4.2.4.10 dc1394_external_trigger_set_polarity() . . . . . . . . . . . . . . . . . . . . . . .\n+4.3.2.2 dc1394featureset_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 34\n \n-4.2.4.11 dc1394_external_trigger_set_power() . . . . . . . . . . . . . . . . . . . . . . . .\n+4.3.3 Enumeration Type Documentation\n+\n+. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 34\n \n-4.2.4.12 dc1394_external_trigger_set_source() . . . . . . . . . . . . . . . . . . . . . . .\n+4.3.3.1 dc1394feature_mode_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 34\n \n-4.2.4.13 dc1394_feature_get() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.3.3.2 dc1394feature_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 34\n \n-4.2.4.14 dc1394_feature_get_absolute_boundaries() . . . . . . . . . . . . . . . . . . . .\n+4.3.3.3 dc1394trigger_mode_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 35\n \n-4.2.4.15 dc1394_feature_get_absolute_control() . . . . . . . . . . . . . . . . . . . . . . .\n+4.3.3.4 dc1394trigger_polarity_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 35\n \n-4.2.4.16 dc1394_feature_get_absolute_value() . . . . . . . . . . . . . . . . . . . . . . .\n+4.3.3.5 dc1394trigger_source_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 35\n \n-4.2.4.17 dc1394_feature_get_all() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.3.4 Function Documentation\n+\n+. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+\n+4.3.4.1 dc1394_camera_reset()\n \n 35\n \n-4.2.4.18 dc1394_feature_get_boundaries()\n+. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-. . . . . . . . . . . . . . . . . . . . . . . . .\n+35\n+\n+4.3.4.2 dc1394_camera_set_power() . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 35\n \n-. . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.3.4.3 dc1394_external_trigger_get_mode()\n \n-36\n+. . . . . . . . . . . . . . . . . . . . . . . .\n \n-4.2.4.20 dc1394_feature_get_modes() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+35\n+\n+4.3.4.4 dc1394_external_trigger_get_polarity() . . . . . . . . . . . . . . . . . . . . . . . .\n \n 36\n \n-4.2.4.21 dc1394_feature_get_power() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.3.4.5 dc1394_external_trigger_get_power() . . . . . . . . . . . . . . . . . . . . . . . .\n \n 36\n \n-4.2.4.22 dc1394_feature_get_value() . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.3.4.6 dc1394_external_trigger_get_source() . . . . . . . . . . . . . . . . . . . . . . . .\n \n 36\n \n-4.2.4.23 dc1394_feature_has_absolute_control() . . . . . . . . . . . . . . . . . . . . . .\n+4.3.4.7 dc1394_external_trigger_get_supported_sources() . . . . . . . . . . . . . . . . .\n \n 36\n \n-4.2.4.24 dc1394_feature_is_present() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.3.4.8 dc1394_external_trigger_has_polarity() . . . . . . . . . . . . . . . . . . . . . . .\n \n 36\n \n-4.2.4.19 dc1394_feature_get_mode()\n-\n Generated by Doxygen\n \n \fv\n \n-4.2.4.25 dc1394_feature_is_readable() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.3.4.9 dc1394_external_trigger_set_mode()\n \n-37\n+. . . . . . . . . . . . . . . . . . . . . . . .\n+\n+36\n \n-4.2.4.26 dc1394_feature_is_switchable() . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.3.4.10 dc1394_external_trigger_set_polarity() . . . . . . . . . . . . . . . . . . . . . . .\n \n 37\n \n-4.2.4.27 dc1394_feature_print()\n-\n-. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.3.4.11 dc1394_external_trigger_set_power() . . . . . . . . . . . . . . . . . . . . . . . .\n \n 37\n \n-4.2.4.28 dc1394_feature_print_all() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.3.4.12 dc1394_external_trigger_set_source() . . . . . . . . . . . . . . . . . . . . . . .\n \n 37\n \n-4.2.4.29 dc1394_feature_set_absolute_control() . . . . . . . . . . . . . . . . . . . . . . .\n+4.3.4.13 dc1394_feature_get() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 37\n \n-4.2.4.30 dc1394_feature_set_absolute_value()\n+4.3.4.14 dc1394_feature_get_absolute_boundaries() . . . . . . . . . . . . . . . . . . . .\n \n-. . . . . . . . . . . . . . . . . . . . . . .\n+37\n+\n+4.3.4.15 dc1394_feature_get_absolute_control() . . . . . . . . . . . . . . . . . . . . . . .\n \n 37\n \n-. . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.3.4.16 dc1394_feature_get_absolute_value() . . . . . . . . . . . . . . . . . . . . . . .\n \n 38\n \n-4.2.4.32 dc1394_feature_set_power() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.3.4.17 dc1394_feature_get_all() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 38\n \n-4.2.4.33 dc1394_feature_set_value() . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.3.4.18 dc1394_feature_get_boundaries()\n \n-38\n+. . . . . . . . . . . . . . . . . . . . . . . . .\n \n-4.2.4.34 dc1394_feature_temperature_get_value()\n+38\n \n-. . . . . . . . . . . . . . . . . . . . .\n+. . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 38\n \n-4.2.4.35 dc1394_feature_temperature_set_value() . . . . . . . . . . . . . . . . . . . . . .\n+4.3.4.20 dc1394_feature_get_modes() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 38\n \n-4.2.4.36 dc1394_feature_whitebalance_get_value() . . . . . . . . . . . . . . . . . . . . .\n+4.3.4.21 dc1394_feature_get_power() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 38\n \n-4.2.4.37 dc1394_feature_whitebalance_set_value() . . . . . . . . . . . . . . . . . . . . .\n+4.3.4.22 dc1394_feature_get_value() . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+\n+39\n+\n+4.3.4.23 dc1394_feature_has_absolute_control() . . . . . . . . . . . . . . . . . . . . . .\n \n 39\n \n-4.2.4.38 dc1394_feature_whiteshading_get_value() . . . . . . . . . . . . . . . . . . . . .\n+4.3.4.24 dc1394_feature_is_present() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 39\n \n-4.2.4.39 dc1394_feature_whiteshading_set_value() . . . . . . . . . . . . . . . . . . . . .\n+4.3.4.25 dc1394_feature_is_readable() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 39\n \n-4.2.4.40 dc1394_memory_busy() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.3.4.26 dc1394_feature_is_switchable() . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 39\n \n-4.2.4.41 dc1394_memory_load() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.3.4.27 dc1394_feature_print()\n+\n+. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 39\n \n-4.2.4.42 dc1394_memory_save() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.3.4.28 dc1394_feature_print_all() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 40\n \n-4.2.4.43 dc1394_pio_get() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.3.4.29 dc1394_feature_set_absolute_control() . . . . . . . . . . . . . . . . . . . . . . .\n \n 40\n \n-4.2.4.44 dc1394_pio_set() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.3.4.30 dc1394_feature_set_absolute_value()\n+\n+. . . . . . . . . . . . . . . . . . . . . . .\n \n 40\n \n-4.2.4.45 dc1394_software_trigger_get_power() . . . . . . . . . . . . . . . . . . . . . . .\n+. . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 40\n \n-4.2.4.46 dc1394_software_trigger_set_power() . . . . . . . . . . . . . . . . . . . . . . .\n+4.3.4.32 dc1394_feature_set_power() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 40\n \n-4.3 dc1394/conversions.h File Reference . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.3.4.33 dc1394_feature_set_value() . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 40\n \n-4.3.1 Detailed Description . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.3.4.34 dc1394_feature_temperature_get_value()\n \n-41\n+. . . . . . . . . . . . . . . . . . . . .\n \n-4.3.2 Enumeration Type Documentation\n+41\n \n-. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.3.4.35 dc1394_feature_temperature_set_value() . . . . . . . . . . . . . . . . . . . . . .\n \n 41\n \n-4.3.2.1 dc1394bayer_method_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.3.4.36 dc1394_feature_whitebalance_get_value() . . . . . . . . . . . . . . . . . . . . .\n \n 41\n \n-4.3.2.2 dc1394stereo_method_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.3.4.37 dc1394_feature_whitebalance_set_value() . . . . . . . . . . . . . . . . . . . . .\n \n 41\n \n-4.2.4.31 dc1394_feature_set_mode()\n+4.3.4.38 dc1394_feature_whiteshading_get_value() . . . . . . . . . . . . . . . . . . . . .\n \n-4.3.3 Function Documentation\n+41\n \n-. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.3.4.39 dc1394_feature_whiteshading_set_value() . . . . . . . . . . . . . . . . . . . . .\n \n 42\n \n-4.3.3.1 dc1394_bayer_decoding_16bit() . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.3.4.40 dc1394_memory_busy() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 42\n \n-4.3.3.2 dc1394_bayer_decoding_8bit() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.3.4.41 dc1394_memory_load() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 42\n \n-4.3.3.3 dc1394_convert_frames() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.3.4.42 dc1394_memory_save() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 42\n \n-4.3.3.4 dc1394_convert_to_MONO8() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.3.4.43 dc1394_pio_get() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 42\n \n-4.3.3.5 dc1394_convert_to_RGB8() . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.3.4.44 dc1394_pio_set() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-43\n+42\n \n-4.3.3.6 dc1394_convert_to_YUV422() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.3.4.45 dc1394_software_trigger_get_power() . . . . . . . . . . . . . . . . . . . . . . .\n \n 43\n \n-4.3.3.7 dc1394_debayer_frames() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.3.4.46 dc1394_software_trigger_set_power() . . . . . . . . . . . . . . . . . . . . . . .\n \n 43\n \n-4.3.3.8 dc1394_deinterlace_stereo() . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.4 dc1394/conversions.h File Reference . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 43\n \n-4.3.3.9 dc1394_deinterlace_stereo_frames() . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.4.1 Detailed Description . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 44\n \n-4.4 dc1394/dc1394.h File Reference . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n-\n-44\n+4.4.2 Enumeration Type Documentation\n \n-4.4.1 Detailed Description . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 44\n \n-4.5 dc1394/format7.h File Reference . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.4.2.1 dc1394bayer_method_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 44\n \n-4.5.1 Detailed Description . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.3.4.19 dc1394_feature_get_mode()\n \n-46\n-\n-4.5.2 Typedef Documentation . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n-\n-46\n+4.3.4.31 dc1394_feature_set_mode()\n \n Generated by Doxygen\n \n \fvi\n \n-4.5.2.1 dc1394format7mode_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.4.2.2 dc1394stereo_method_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.4.3 Function Documentation\n \n-46\n+44\n \n-4.5.2.2 dc1394format7modeset_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-46\n+44\n \n-4.5.3 Function Documentation\n+4.4.3.1 dc1394_bayer_decoding_16bit() . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+44\n \n-46\n+4.4.3.2 dc1394_bayer_decoding_8bit() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-4.5.3.1 dc1394_format7_get_color_coding() . . . . . . . . . . . . . . . . . . . . . . . . .\n+45\n \n-46\n+4.4.3.3 dc1394_convert_frames() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-4.5.3.2 dc1394_format7_get_color_codings() . . . . . . . . . . . . . . . . . . . . . . . .\n+45\n \n-46\n+4.4.3.4 dc1394_convert_to_MONO8() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-4.5.3.3 dc1394_format7_get_color_filter() . . . . . . . . . . . . . . . . . . . . . . . . . .\n+45\n \n-47\n+4.4.3.5 dc1394_convert_to_RGB8() . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-4.5.3.4 dc1394_format7_get_data_depth() . . . . . . . . . . . . . . . . . . . . . . . . . .\n+45\n \n-47\n+4.4.3.6 dc1394_convert_to_YUV422() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-4.5.3.5 dc1394_format7_get_frame_interval() . . . . . . . . . . . . . . . . . . . . . . . .\n+46\n \n-47\n+4.4.3.7 dc1394_debayer_frames() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-4.5.3.6 dc1394_format7_get_image_position() . . . . . . . . . . . . . . . . . . . . . . . .\n+46\n \n-47\n+4.4.3.8 dc1394_deinterlace_stereo() . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-4.5.3.7 dc1394_format7_get_image_size() . . . . . . . . . . . . . . . . . . . . . . . . . .\n+46\n \n-47\n+4.4.3.9 dc1394_deinterlace_stereo_frames() . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-4.5.3.8 dc1394_format7_get_max_image_size() . . . . . . . . . . . . . . . . . . . . . . .\n+46\n \n-48\n+4.5 dc1394/dc1394.h File Reference . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-4.5.3.9 dc1394_format7_get_mode_info() . . . . . . . . . . . . . . . . . . . . . . . . . .\n+47\n \n-48\n+4.5.1 Detailed Description . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-4.5.3.10 dc1394_format7_get_modeset()\n+47\n \n-. . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.6 dc1394/format7.h File Reference . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-48\n+47\n \n-4.5.3.11 dc1394_format7_get_packet_parameters() . . . . . . . . . . . . . . . . . . . . .\n+4.6.1 Detailed Description . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 48\n \n-4.5.3.12 dc1394_format7_get_packet_size() . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.6.2 Typedef Documentation . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-48\n+49\n \n-4.5.3.13 dc1394_format7_get_packets_per_frame() . . . . . . . . . . . . . . . . . . . . .\n+4.6.2.1 dc1394format7mode_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 49\n \n-4.5.3.14 dc1394_format7_get_pixel_number() . . . . . . . . . . . . . . . . . . . . . . . .\n+4.6.2.2 dc1394format7modeset_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 49\n \n-4.5.3.15 dc1394_format7_get_recommended_packet_size()\n+4.6.3 Function Documentation\n \n-. . . . . . . . . . . . . . . .\n+. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 49\n \n-4.5.3.16 dc1394_format7_get_roi() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.6.3.1 dc1394_format7_get_color_coding() . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 49\n \n-4.5.3.17 dc1394_format7_get_total_bytes() . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.6.3.2 dc1394_format7_get_color_codings() . . . . . . . . . . . . . . . . . . . . . . . .\n \n 49\n \n-4.5.3.18 dc1394_format7_get_unit_position() . . . . . . . . . . . . . . . . . . . . . . . .\n+4.6.3.3 dc1394_format7_get_color_filter() . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-50\n+49\n \n-4.5.3.19 dc1394_format7_get_unit_size() . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.6.3.4 dc1394_format7_get_data_depth() . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 50\n \n-4.5.3.20 dc1394_format7_set_color_coding() . . . . . . . . . . . . . . . . . . . . . . . .\n+4.6.3.5 dc1394_format7_get_frame_interval() . . . . . . . . . . . . . . . . . . . . . . . .\n \n 50\n \n-4.5.3.21 dc1394_format7_set_image_position() . . . . . . . . . . . . . . . . . . . . . . .\n+4.6.3.6 dc1394_format7_get_image_position() . . . . . . . . . . . . . . . . . . . . . . . .\n \n 50\n \n-4.5.3.22 dc1394_format7_set_image_size() . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.6.3.7 dc1394_format7_get_image_size() . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 50\n \n-4.5.3.23 dc1394_format7_set_packet_size() . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.6.3.8 dc1394_format7_get_max_image_size() . . . . . . . . . . . . . . . . . . . . . . .\n \n-51\n+50\n \n-4.5.3.24 dc1394_format7_set_roi() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.6.3.9 dc1394_format7_get_mode_info() . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 51\n \n-4.6 dc1394/iso.h File Reference . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.6.3.10 dc1394_format7_get_modeset()\n+\n+. . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 51\n \n-4.6.1 Detailed Description . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.6.3.11 dc1394_format7_get_packet_parameters() . . . . . . . . . . . . . . . . . . . . .\n \n 51\n \n-4.6.2 Function Documentation\n+4.6.3.12 dc1394_format7_get_packet_size() . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n-\n-52\n+51\n \n-4.6.2.1 dc1394_iso_allocate_bandwidth() . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.6.3.13 dc1394_format7_get_packets_per_frame() . . . . . . . . . . . . . . . . . . . . .\n \n-52\n+51\n \n-4.6.2.2 dc1394_iso_allocate_channel() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.6.3.14 dc1394_format7_get_pixel_number() . . . . . . . . . . . . . . . . . . . . . . . .\n \n 52\n \n-4.6.2.3 dc1394_iso_release_all() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n-\n-53\n+4.6.3.15 dc1394_format7_get_recommended_packet_size()\n \n-4.6.2.4 dc1394_iso_release_bandwidth()\n-\n-. . . . . . . . . . . . . . . . . . . . . . . . . .\n-\n-53\n+. . . . . . . . . . . . . . . .\n \n-4.6.2.5 dc1394_iso_release_channel() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+52\n \n-54\n+4.6.3.16 dc1394_format7_get_roi() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-4.6.2.6 dc1394_iso_set_persist() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+52\n \n-54\n+4.6.3.17 dc1394_format7_get_total_bytes() . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-4.7 dc1394/capture.h File Reference . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+52\n \n-54\n+4.6.3.18 dc1394_format7_get_unit_position() . . . . . . . . . . . . . . . . . . . . . . . .\n \n-4.7.1 Detailed Description . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+52\n \n-55\n+4.6.3.19 dc1394_format7_get_unit_size() . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-4.7.2 Macro Definition Documentation\n+53\n \n-. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.6.3.20 dc1394_format7_set_color_coding() . . . . . . . . . . . . . . . . . . . . . . . .\n \n-55\n+53\n \n-4.7.2.1 DC1394_CAPTURE_FLAGS_CHANNEL_ALLOC . . . . . . . . . . . . . . . . . .\n+4.6.3.21 dc1394_format7_set_image_position() . . . . . . . . . . . . . . . . . . . . . . .\n \n-55\n+53\n \n-4.7.3 Typedef Documentation . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.6.3.22 dc1394_format7_set_image_size() . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-56\n+53\n \n-4.7.3.1 dc1394capture_callback_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.6.3.23 dc1394_format7_set_packet_size() . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-56\n+53\n \n Generated by Doxygen\n \n \fvii\n \n-4.7.4 Enumeration Type Documentation\n-\n-. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n-\n-56\n+4.6.3.24 dc1394_format7_set_roi() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-4.7.4.1 dc1394capture_policy_t\n+54\n \n-. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.7 dc1394/iso.h File Reference . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-56\n+54\n \n-. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.7.1 Detailed Description . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-56\n+54\n \n-4.7.5 Function Documentation\n+4.7.2 Function Documentation\n \n-4.7.5.1 dc1394_capture_dequeue()\n+. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-. . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+54\n \n-56\n+4.7.2.1 dc1394_iso_allocate_bandwidth() . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-4.7.5.2 dc1394_capture_enqueue()\n+54\n \n-. . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.7.2.2 dc1394_iso_allocate_channel() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-56\n+55\n \n-4.7.5.3 dc1394_capture_get_fileno() . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.7.2.3 dc1394_iso_release_all() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 56\n \n-4.7.5.4 dc1394_capture_is_frame_corrupt() . . . . . . . . . . . . . . . . . . . . . . . . .\n-\n-57\n+4.7.2.4 dc1394_iso_release_bandwidth()\n \n-4.7.5.5 dc1394_capture_set_callback() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+. . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-57\n+56\n \n-4.7.5.6 dc1394_capture_setup() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.7.2.5 dc1394_iso_release_channel() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-57\n+56\n \n-4.7.5.7 dc1394_capture_stop() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.7.2.6 dc1394_iso_set_persist() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 57\n \n 4.8 dc1394/log.h File Reference . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 57\n \n@@ -2124,20 +2123,20 @@\n No docs yet . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n dc1394/vendor/ pixelink.h\n No docs yet . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n Generated by Doxygen\n \n 25\n-54\n 29\n-40\n-44\n-44\n-51\n+32\n+43\n+47\n+47\n+54\n 57\n 60\n 64\n 65\n 91\n 68\n 81\n@@ -3441,15 +3440,15 @@\n dc1394_t \u2217 dc1394_new (\n void )\n \n Creates a new context in which cameras can be searched and used. This should be called before using any other\n libdc1394 function.\n Generated by Doxygen\n \n-\f4.2 dc1394/control.h File Reference\n+\f4.2 dc1394/capture.h File Reference\n \n 4.1.4.12\n \n 29\n \n dc1394_reset_bus()\n \n@@ -3459,14 +3458,190 @@\n Resets the IEEE1394 bus which camera is attached to. Calling this function is \"rude\" to other devices because it\n causes them to re-enumerate on the bus and may cause a temporary disruption in their current activities. Thus,\n use it sparingly. Its primary use is if a program shuts down uncleanly and needs to free leftover ISO channels or\n bandwidth. A bus reset will free those things as a side effect.\n \n 4.2\n \n+dc1394/capture.h File Reference\n+\n+Capture functions.\n+\n+#include <dc1394/log.h>\n+#include <dc1394/video.h>\n+\n+Macros\n+\u2022 #define DC1394_CAPTURE_FLAGS_CHANNEL_ALLOC 0x00000001U\n+\n+Typedefs\n+\u2022 typedef void(\u2217 dc1394capture_callback_t) ( dc1394camera_t \u2217, void \u2217)\n+\n+Enumerations\n+\u2022 enum dc1394capture_policy_t\n+\n+Functions\n+\u2022 dc1394error_t dc1394_capture_setup ( dc1394camera_t \u2217camera, uint32_t num_dma_buffers, uint32_t\n+flags)\n+\u2022 dc1394error_t dc1394_capture_stop ( dc1394camera_t \u2217camera)\n+\u2022 int dc1394_capture_get_fileno ( dc1394camera_t \u2217camera)\n+\u2022 dc1394error_t dc1394_capture_dequeue ( dc1394camera_t \u2217camera, dc1394capture_policy_t policy,\n+dc1394video_frame_t \u2217\u2217frame)\n+\u2022 dc1394error_t dc1394_capture_enqueue ( dc1394camera_t \u2217camera, dc1394video_frame_t \u2217frame)\n+\u2022 dc1394bool_t dc1394_capture_is_frame_corrupt ( dc1394camera_t \u2217camera, dc1394video_frame_t\n+\u2217frame)\n+\u2022 void dc1394_capture_set_callback ( dc1394camera_t \u2217camera, dc1394capture_callback_t callback,\n+void \u2217user_data)\n+\n+Generated by Doxygen\n+\n+\f30\n+\n+File Documentation\n+\n+4.2.1\n+\n+Detailed Description\n+\n+Capture functions.\n+Author\n+Damien Douxchamps: coding\n+Peter Antoniac: documentation maintainer\n+\n+More details soon\n+\n+4.2.2\n+\n+Macro Definition Documentation\n+\n+4.2.2.1\n+\n+DC1394_CAPTURE_FLAGS_CHANNEL_ALLOC\n+\n+#define DC1394_CAPTURE_FLAGS_CHANNEL_ALLOC 0x00000001U\n+\n+Capture flags. Currently limited to switching automatic functions on/off: channel allocation, bandwidth allocation\n+and automatic starting of ISO transmission\n+\n+4.2.3\n+\n+Typedef Documentation\n+\n+4.2.3.1\n+\n+dc1394capture_callback_t\n+\n+typedef void(\u2217 dc1394capture_callback_t) ( dc1394camera_t \u2217, void \u2217)\n+\n+typedef for the callback param for dc1394_capture_set_callback\n+\n+4.2.4\n+\n+Enumeration Type Documentation\n+\n+4.2.4.1\n+\n+dc1394capture_policy_t\n+\n+enum\n+\n+dc1394capture_policy_t\n+\n+The capture policy.\n+Can be blocking (wait for a frame forever) or polling (returns if no frames is in the ring buffer)\n+\n+4.2.5\n+\n+Function Documentation\n+\n+4.2.5.1\n+\n+dc1394_capture_dequeue()\n+\n+dc1394error_t dc1394_capture_dequeue (\n+dc1394camera_t \u2217 camera,\n+dc1394capture_policy_t policy,\n+dc1394video_frame_t \u2217\u2217 frame )\n+\n+Captures a video frame. The returned struct contains the image buffer, among others. This image buffer SHALL\n+NOT be freed, as it represents an area in the memory that belongs to the system.\n+Generated by Doxygen\n+\n+\f4.2 dc1394/capture.h File Reference\n+\n+4.2.5.2\n+\n+31\n+\n+dc1394_capture_enqueue()\n+\n+dc1394error_t dc1394_capture_enqueue (\n+dc1394camera_t \u2217 camera,\n+dc1394video_frame_t \u2217 frame )\n+\n+Returns a frame to the ring buffer once it has been used.\n+\n+4.2.5.3\n+\n+dc1394_capture_get_fileno()\n+\n+int dc1394_capture_get_fileno (\n+dc1394camera_t \u2217 camera )\n+\n+Gets a file descriptor to be used for select(). Must be called after dc1394_capture_setup() (p. 31).\n+\n+4.2.5.4\n+\n+dc1394_capture_is_frame_corrupt()\n+\n+dc1394bool_t dc1394_capture_is_frame_corrupt (\n+dc1394camera_t \u2217 camera,\n+dc1394video_frame_t \u2217 frame )\n+\n+Returns DC1394_TRUE if the given frame (previously dequeued) has been detected to be corrupt (missing data,\n+corrupted data, overrun buffer, etc.). Note that certain types of corruption may go undetected in which case\n+DC1394_FALSE will be returned. The ability to detect corruption also varies between platforms. Note that corrupt frames still need to be enqueued with dc1394_capture_enqueue() (p. 30) when no longer needed by the user.\n+\n+4.2.5.5\n+\n+dc1394_capture_set_callback()\n+\n+void dc1394_capture_set_callback (\n+dc1394camera_t \u2217 camera,\n+dc1394capture_callback_t callback,\n+void \u2217 user_data )\n+\n+Set a callback if supported by the platform (OS X only for now).\n+\n+4.2.5.6\n+\n+dc1394_capture_setup()\n+\n+dc1394error_t dc1394_capture_setup (\n+dc1394camera_t \u2217 camera,\n+uint32_t num_dma_buffers,\n+uint32_t flags )\n+\n+Setup the capture, using a ring buffer of a certain size (num_dma_buffers) and certain options (flags)\n+\n+4.2.5.7\n+\n+dc1394_capture_stop()\n+\n+dc1394error_t dc1394_capture_stop (\n+dc1394camera_t \u2217 camera )\n+\n+Stop the capture\n+Generated by Doxygen\n+\n+\f32\n+\n+File Documentation\n+\n+4.3\n+\n dc1394/control.h File Reference\n \n Diverse controls of camera features.\n \n #include <dc1394/log.h>\n \n Data Structures\n@@ -3483,20 +3658,14 @@\n Enumerations\n \u2022 enum dc1394trigger_mode_t\n \u2022 enum dc1394feature_t\n \u2022 enum dc1394trigger_source_t\n \u2022 enum dc1394trigger_polarity_t\n \u2022 enum dc1394feature_mode_t\n \n-Generated by Doxygen\n-\n-\f30\n-\n-File Documentation\n-\n Functions\n dc1394error_t dc1394_feature_get_all ( dc1394camera_t \u2217camera, dc1394featureset_t \u2217features)\n dc1394error_t dc1394_feature_get ( dc1394camera_t \u2217camera, dc1394feature_info_t \u2217feature)\n dc1394error_t dc1394_feature_print ( dc1394feature_info_t \u2217feature, FILE \u2217fd)\n dc1394error_t dc1394_feature_print_all ( dc1394featureset_t \u2217features, FILE \u2217fd)\n dc1394error_t dc1394_feature_whitebalance_get_value ( dc1394camera_t \u2217camera, uint32_t \u2217u_b_\u2190value, uint32_t \u2217v_r_value)\n \u2022 dc1394error_t dc1394_feature_whitebalance_set_value ( dc1394camera_t \u2217camera, uint32_t u_b_\u2190value, uint32_t v_r_value)\n@@ -3506,15 +3675,28 @@\n uint32_t \u2217g_value, uint32_t \u2217b_value)\n \u2022 dc1394error_t dc1394_feature_whiteshading_set_value ( dc1394camera_t \u2217camera, uint32_t r_value,\n uint32_t g_value, uint32_t b_value)\n \u2022 dc1394error_t dc1394_feature_get_value ( dc1394camera_t \u2217camera, dc1394feature_t feature,\n uint32_t \u2217value)\n \u2022 dc1394error_t dc1394_feature_set_value ( dc1394camera_t \u2217camera, dc1394feature_t feature,\n uint32_t value)\n-\u2022 dc1394error_t dc1394_feature_is_present ( dc1394camera_t \u2217camera, dc1394feature_t feature,\n+\n+\u2022\n+\u2022\n+\u2022\n+\u2022\n+\u2022\n+\n+Generated by Doxygen\n+\n+\f4.3 dc1394/control.h File Reference\n+\n+33\n+\n+dc1394error_t dc1394_feature_is_present ( dc1394camera_t \u2217camera, dc1394feature_t feature,\n dc1394bool_t \u2217value)\n \u2022 dc1394error_t dc1394_feature_is_readable ( dc1394camera_t \u2217camera, dc1394feature_t feature,\n dc1394bool_t \u2217value)\n \u2022 dc1394error_t dc1394_feature_get_boundaries ( dc1394camera_t \u2217camera, dc1394feature_t feature,\n uint32_t \u2217min, uint32_t \u2217max)\n \u2022 dc1394error_t dc1394_feature_is_switchable ( dc1394camera_t \u2217camera, dc1394feature_t feature,\n dc1394bool_t \u2217value)\n@@ -3535,28 +3717,15 @@\n \u2022 dc1394error_t dc1394_feature_set_absolute_value ( dc1394camera_t \u2217camera, dc1394feature_\u2190t feature, float value)\n \u2022 dc1394error_t dc1394_feature_get_absolute_control ( dc1394camera_t \u2217camera, dc1394feature_t\n feature, dc1394switch_t \u2217pwr)\n \u2022 dc1394error_t dc1394_feature_set_absolute_control ( dc1394camera_t \u2217camera, dc1394feature_t\n feature, dc1394switch_t pwr)\n \u2022 dc1394error_t dc1394_external_trigger_set_polarity ( dc1394camera_t \u2217camera, dc1394trigger_\u2190polarity_t polarity)\n \u2022 dc1394error_t dc1394_external_trigger_get_polarity ( dc1394camera_t \u2217camera, dc1394trigger_\u2190polarity_t \u2217polarity)\n-\n-\u2022\n-\u2022\n-\u2022\n-\u2022\n-\u2022\n-\n-Generated by Doxygen\n-\n-\f4.2 dc1394/control.h File Reference\n-\n-31\n-\n-dc1394error_t dc1394_external_trigger_has_polarity ( dc1394camera_t \u2217camera, dc1394bool_\u2190t \u2217polarity_capable)\n+\u2022 dc1394error_t dc1394_external_trigger_has_polarity ( dc1394camera_t \u2217camera, dc1394bool_\u2190t \u2217polarity_capable)\n \u2022 dc1394error_t dc1394_external_trigger_set_power ( dc1394camera_t \u2217camera, dc1394switch_t pwr)\n \u2022 dc1394error_t dc1394_external_trigger_get_power ( dc1394camera_t \u2217camera, dc1394switch_t \u2217pwr)\n \u2022 dc1394error_t dc1394_external_trigger_set_mode ( dc1394camera_t \u2217camera, dc1394trigger_\u2190mode_t mode)\n \u2022 dc1394error_t dc1394_external_trigger_get_mode ( dc1394camera_t \u2217camera, dc1394trigger_\u2190mode_t \u2217mode)\n \u2022 dc1394error_t dc1394_external_trigger_set_source ( dc1394camera_t \u2217camera, dc1394trigger_\u2190source_t source)\n \u2022 dc1394error_t dc1394_external_trigger_get_source ( dc1394camera_t \u2217camera, dc1394trigger_\u2190source_t \u2217source)\n \u2022 dc1394error_t\n@@ -3567,668 +3736,666 @@\n \u2022 dc1394error_t dc1394_pio_set ( dc1394camera_t \u2217camera, uint32_t value)\n \u2022 dc1394error_t dc1394_pio_get ( dc1394camera_t \u2217camera, uint32_t \u2217value)\n \u2022 dc1394error_t dc1394_camera_reset ( dc1394camera_t \u2217camera)\n \u2022 dc1394error_t dc1394_camera_set_power ( dc1394camera_t \u2217camera, dc1394switch_t pwr)\n \u2022 dc1394error_t dc1394_memory_busy ( dc1394camera_t \u2217camera, dc1394bool_t \u2217value)\n \u2022 dc1394error_t dc1394_memory_save ( dc1394camera_t \u2217camera, uint32_t channel)\n \u2022 dc1394error_t dc1394_memory_load ( dc1394camera_t \u2217camera, uint32_t channel)\n-\n \u2022\n \n-4.2.1\n+Generated by Doxygen\n+\n+\f34\n+\n+File Documentation\n+\n+4.3.1\n \n Detailed Description\n \n Diverse controls of camera features.\n Author\n Gord Peters: main writer\n Chris Urmson: some additions\n Damien Douxchamps: some additions\n Peter Antoniac: documentation maintainer\n Rudolf Leitgeb: documentation writer\n \n This is the main include file of the library. It lists most of the library functions, enumerations and data structures.\n \n-4.2.2\n+4.3.2\n \n Typedef Documentation\n \n-4.2.2.1\n+4.3.2.1\n \n dc1394feature_info_t\n \n typedef struct\n \n __dc1394feature_info_t_struct\n \n dc1394feature_info_t\n \n A structure containing all information about a feature.\n Some fields are only valid for some features (e.g. trigger, white balance,...)\n \n-Generated by Doxygen\n-\n-\f32\n-\n-4.2.2.2\n-\n-File Documentation\n+4.3.2.2\n \n dc1394featureset_t\n \n typedef struct\n \n __dc1394featureset_t\n \n dc1394featureset_t\n \n The list of features\n \n-4.2.3\n+4.3.3\n \n Enumeration Type Documentation\n \n-4.2.3.1\n+4.3.3.1\n \n dc1394feature_mode_t\n \n enum\n \n dc1394feature_mode_t\n \n Control modes for a feature (excl. absolute control)\n \n-4.2.3.2\n+4.3.3.2\n \n enum\n \n dc1394feature_t\n \n dc1394feature_t\n \n Enumeration of camera features\n \n-4.2.3.3\n+Generated by Doxygen\n+\n+\f4.3 dc1394/control.h File Reference\n+\n+4.3.3.3\n \n enum\n \n dc1394trigger_mode_t\n \n dc1394trigger_mode_t\n \n Enumeration of trigger modes\n \n-4.2.3.4\n+4.3.3.4\n \n dc1394trigger_polarity_t\n \n enum\n \n dc1394trigger_polarity_t\n \n External trigger polarity\n \n-4.2.3.5\n+4.3.3.5\n \n dc1394trigger_source_t\n \n enum\n \n dc1394trigger_source_t\n \n Enumeration of trigger sources\n \n-4.2.4\n+4.3.4\n \n Function Documentation\n \n-4.2.4.1\n+4.3.4.1\n \n dc1394_camera_reset()\n \n dc1394error_t dc1394_camera_reset (\n dc1394camera_t \u2217 camera )\n \n reset a camera to factory default settings\n-Generated by Doxygen\n \n-\f4.2 dc1394/control.h File Reference\n-\n-4.2.4.2\n+4.3.4.2\n \n dc1394_camera_set_power()\n \n dc1394error_t dc1394_camera_set_power (\n dc1394camera_t \u2217 camera,\n dc1394switch_t pwr )\n \n turn a camera on or off\n \n-4.2.4.3\n+4.3.4.3\n \n dc1394_external_trigger_get_mode()\n \n dc1394error_t dc1394_external_trigger_get_mode (\n dc1394camera_t \u2217 camera,\n dc1394trigger_mode_t \u2217 mode )\n \n Gets the external trigger mode\n \n-4.2.4.4\n+Generated by Doxygen\n+\n+35\n+\n+\f36\n+\n+4.3.4.4\n+\n+File Documentation\n \n dc1394_external_trigger_get_polarity()\n \n dc1394error_t dc1394_external_trigger_get_polarity (\n dc1394camera_t \u2217 camera,\n dc1394trigger_polarity_t \u2217 polarity )\n \n Gets the polarity of the external trigger\n \n-4.2.4.5\n+4.3.4.5\n \n dc1394_external_trigger_get_power()\n \n dc1394error_t dc1394_external_trigger_get_power (\n dc1394camera_t \u2217 camera,\n dc1394switch_t \u2217 pwr )\n \n Gets the status of the external trigger\n \n-4.2.4.6\n+4.3.4.6\n \n dc1394_external_trigger_get_source()\n \n dc1394error_t dc1394_external_trigger_get_source (\n dc1394camera_t \u2217 camera,\n dc1394trigger_source_t \u2217 source )\n \n Gets the external trigger source\n \n-4.2.4.7\n+4.3.4.7\n \n dc1394_external_trigger_get_supported_sources()\n \n dc1394error_t dc1394_external_trigger_get_supported_sources (\n dc1394camera_t \u2217 camera,\n dc1394trigger_sources_t \u2217 sources )\n \n Gets the list of available external trigger source\n \n-Generated by Doxygen\n-\n-33\n-\n-\f34\n-\n-4.2.4.8\n-\n-File Documentation\n+4.3.4.8\n \n dc1394_external_trigger_has_polarity()\n \n dc1394error_t dc1394_external_trigger_has_polarity (\n dc1394camera_t \u2217 camera,\n dc1394bool_t \u2217 polarity_capable )\n \n Tells whether the external trigger can change its polarity or not.\n \n-4.2.4.9\n+4.3.4.9\n \n dc1394_external_trigger_set_mode()\n \n dc1394error_t dc1394_external_trigger_set_mode (\n dc1394camera_t \u2217 camera,\n dc1394trigger_mode_t mode )\n \n Sets the external trigger mode\n \n-4.2.4.10\n+Generated by Doxygen\n+\n+\f4.3 dc1394/control.h File Reference\n+\n+4.3.4.10\n \n dc1394_external_trigger_set_polarity()\n \n dc1394error_t dc1394_external_trigger_set_polarity (\n dc1394camera_t \u2217 camera,\n dc1394trigger_polarity_t polarity )\n \n Sets the polarity of the external trigger\n \n-4.2.4.11\n+4.3.4.11\n \n dc1394_external_trigger_set_power()\n \n dc1394error_t dc1394_external_trigger_set_power (\n dc1394camera_t \u2217 camera,\n dc1394switch_t pwr )\n \n Switch between internal and external trigger\n \n-4.2.4.12\n+4.3.4.12\n \n dc1394_external_trigger_set_source()\n \n dc1394error_t dc1394_external_trigger_set_source (\n dc1394camera_t \u2217 camera,\n dc1394trigger_source_t source )\n \n Sets the external trigger source\n \n-4.2.4.13\n+4.3.4.13\n \n dc1394_feature_get()\n \n dc1394error_t dc1394_feature_get (\n dc1394camera_t \u2217 camera,\n dc1394feature_info_t \u2217 feature )\n \n Stores the bounds and options associated with the feature described by feature->feature_id\n \n-Generated by Doxygen\n-\n-\f4.2 dc1394/control.h File Reference\n-\n-4.2.4.14\n+4.3.4.14\n \n dc1394_feature_get_absolute_boundaries()\n \n dc1394error_t dc1394_feature_get_absolute_boundaries (\n dc1394camera_t \u2217 camera,\n dc1394feature_t feature,\n float \u2217 min,\n float \u2217 max )\n \n Gets the absolute boundaries of a feature\n \n-4.2.4.15\n+4.3.4.15\n \n dc1394_feature_get_absolute_control()\n \n dc1394error_t dc1394_feature_get_absolute_control (\n dc1394camera_t \u2217 camera,\n dc1394feature_t feature,\n dc1394switch_t \u2217 pwr )\n \n Gets the status of absolute control of a feature\n+Generated by Doxygen\n \n-4.2.4.16\n+37\n+\n+\f38\n+\n+4.3.4.16\n+\n+File Documentation\n \n dc1394_feature_get_absolute_value()\n \n dc1394error_t dc1394_feature_get_absolute_value (\n dc1394camera_t \u2217 camera,\n dc1394feature_t feature,\n float \u2217 value )\n \n Gets the absolute value of a feature\n \n-4.2.4.17\n+4.3.4.17\n \n dc1394_feature_get_all()\n \n dc1394error_t dc1394_feature_get_all (\n dc1394camera_t \u2217 camera,\n dc1394featureset_t \u2217 features )\n \n Collects the available features for the camera described by node and stores them in features.\n \n-4.2.4.18\n+4.3.4.18\n \n dc1394_feature_get_boundaries()\n \n dc1394error_t dc1394_feature_get_boundaries (\n dc1394camera_t \u2217 camera,\n dc1394feature_t feature,\n uint32_t \u2217 min,\n uint32_t \u2217 max )\n \n Gets the boundaries of a feature\n \n-Generated by Doxygen\n-\n-35\n-\n-\f36\n-\n-4.2.4.19\n-\n-File Documentation\n+4.3.4.19\n \n dc1394_feature_get_mode()\n \n dc1394error_t dc1394_feature_get_mode (\n dc1394camera_t \u2217 camera,\n dc1394feature_t feature,\n dc1394feature_mode_t \u2217 mode )\n \n Gets the current control modes for a feature\n \n-4.2.4.20\n+4.3.4.20\n \n dc1394_feature_get_modes()\n \n dc1394error_t dc1394_feature_get_modes (\n dc1394camera_t \u2217 camera,\n dc1394feature_t feature,\n dc1394feature_modes_t \u2217 modes )\n \n Gets the list of control modes for a feature (manual, auto, etc...)\n \n-4.2.4.21\n+4.3.4.21\n \n dc1394_feature_get_power()\n \n dc1394error_t dc1394_feature_get_power (\n dc1394camera_t \u2217 camera,\n dc1394feature_t feature,\n dc1394switch_t \u2217 pwr )\n \n Gets the power status of a feature (ON or OFF)\n+Generated by Doxygen\n+\n+\f4.3 dc1394/control.h File Reference\n \n-4.2.4.22\n+4.3.4.22\n \n dc1394_feature_get_value()\n \n dc1394error_t dc1394_feature_get_value (\n dc1394camera_t \u2217 camera,\n dc1394feature_t feature,\n uint32_t \u2217 value )\n \n Gets the value of a feature\n \n-4.2.4.23\n+4.3.4.23\n \n dc1394_feature_has_absolute_control()\n \n dc1394error_t dc1394_feature_has_absolute_control (\n dc1394camera_t \u2217 camera,\n dc1394feature_t feature,\n dc1394bool_t \u2217 value )\n \n Tells whether a feature can be controlled in absolute mode\n \n-4.2.4.24\n+4.3.4.24\n \n dc1394_feature_is_present()\n \n dc1394error_t dc1394_feature_is_present (\n dc1394camera_t \u2217 camera,\n dc1394feature_t feature,\n dc1394bool_t \u2217 value )\n \n Tells whether a feature is present or not\n-Generated by Doxygen\n-\n-\f4.2 dc1394/control.h File Reference\n \n-4.2.4.25\n+4.3.4.25\n \n dc1394_feature_is_readable()\n \n dc1394error_t dc1394_feature_is_readable (\n dc1394camera_t \u2217 camera,\n dc1394feature_t feature,\n dc1394bool_t \u2217 value )\n \n Tells whether a feature is readable or not\n \n-4.2.4.26\n+4.3.4.26\n \n dc1394_feature_is_switchable()\n \n dc1394error_t dc1394_feature_is_switchable (\n dc1394camera_t \u2217 camera,\n dc1394feature_t feature,\n dc1394bool_t \u2217 value )\n \n Tells whether a feature is switcheable or not (ON/OFF)\n \n-4.2.4.27\n+4.3.4.27\n \n dc1394_feature_print()\n \n dc1394error_t dc1394_feature_print (\n dc1394feature_info_t \u2217 feature,\n FILE \u2217 fd )\n \n Displays the bounds and options of the given feature\n+Generated by Doxygen\n+\n+39\n+\n+\f40\n \n-4.2.4.28\n+4.3.4.28\n+\n+File Documentation\n \n dc1394_feature_print_all()\n \n dc1394error_t dc1394_feature_print_all (\n dc1394featureset_t \u2217 features,\n FILE \u2217 fd )\n \n Displays the bounds and options of every feature supported by the camera\n \n-4.2.4.29\n+4.3.4.29\n \n dc1394_feature_set_absolute_control()\n \n dc1394error_t dc1394_feature_set_absolute_control (\n dc1394camera_t \u2217 camera,\n dc1394feature_t feature,\n dc1394switch_t pwr )\n \n Sets the feature in absolute control mode (ON/OFF)\n \n-4.2.4.30\n+4.3.4.30\n \n dc1394_feature_set_absolute_value()\n \n dc1394error_t dc1394_feature_set_absolute_value (\n dc1394camera_t \u2217 camera,\n dc1394feature_t feature,\n float value )\n \n Sets the absolute value of a feature\n-Generated by Doxygen\n \n-37\n-\n-\f38\n-\n-4.2.4.31\n-\n-File Documentation\n+4.3.4.31\n \n dc1394_feature_set_mode()\n \n dc1394error_t dc1394_feature_set_mode (\n dc1394camera_t \u2217 camera,\n dc1394feature_t feature,\n dc1394feature_mode_t mode )\n \n Sets the current control modes for a feature\n \n-4.2.4.32\n+4.3.4.32\n \n dc1394_feature_set_power()\n \n dc1394error_t dc1394_feature_set_power (\n dc1394camera_t \u2217 camera,\n dc1394feature_t feature,\n dc1394switch_t pwr )\n \n Sets the power status of a feature (ON or OFF)\n \n-4.2.4.33\n+4.3.4.33\n \n dc1394_feature_set_value()\n \n dc1394error_t dc1394_feature_set_value (\n dc1394camera_t \u2217 camera,\n dc1394feature_t feature,\n uint32_t value )\n \n Sets the value of a feature\n+Generated by Doxygen\n+\n+\f4.3 dc1394/control.h File Reference\n+\n+4.3.4.34\n \n-4.2.4.34\n+41\n \n dc1394_feature_temperature_get_value()\n \n dc1394error_t dc1394_feature_temperature_get_value (\n dc1394camera_t \u2217 camera,\n uint32_t \u2217 target_temperature,\n uint32_t \u2217 temperature )\n \n Gets the temperature values (target and current)\n \n-4.2.4.35\n+4.3.4.35\n \n dc1394_feature_temperature_set_value()\n \n dc1394error_t dc1394_feature_temperature_set_value (\n dc1394camera_t \u2217 camera,\n uint32_t target_temperature )\n \n Sets the temperature values (target only) FIXME: COULD BE DROPPED? already in the standard feature_set_\u2190value()?\n \n-4.2.4.36\n+4.3.4.36\n \n dc1394_feature_whitebalance_get_value()\n \n dc1394error_t dc1394_feature_whitebalance_get_value (\n dc1394camera_t \u2217 camera,\n uint32_t \u2217 u_b_value,\n uint32_t \u2217 v_r_value )\n \n Gets the whitebalance values\n-Generated by Doxygen\n \n-\f4.2 dc1394/control.h File Reference\n-\n-4.2.4.37\n+4.3.4.37\n \n dc1394_feature_whitebalance_set_value()\n \n dc1394error_t dc1394_feature_whitebalance_set_value (\n dc1394camera_t \u2217 camera,\n uint32_t u_b_value,\n uint32_t v_r_value )\n \n Sets the whitebalance values\n \n-4.2.4.38\n+4.3.4.38\n \n dc1394_feature_whiteshading_get_value()\n \n dc1394error_t dc1394_feature_whiteshading_get_value (\n dc1394camera_t \u2217 camera,\n uint32_t \u2217 r_value,\n uint32_t \u2217 g_value,\n uint32_t \u2217 b_value )\n \n Gets the white shading values\n \n-4.2.4.39\n+Generated by Doxygen\n+\n+\f42\n+\n+4.3.4.39\n+\n+File Documentation\n \n dc1394_feature_whiteshading_set_value()\n \n dc1394error_t dc1394_feature_whiteshading_set_value (\n dc1394camera_t \u2217 camera,\n uint32_t r_value,\n uint32_t g_value,\n uint32_t b_value )\n \n Sets the white shading values\n \n-4.2.4.40\n+4.3.4.40\n \n dc1394_memory_busy()\n \n dc1394error_t dc1394_memory_busy (\n dc1394camera_t \u2217 camera,\n dc1394bool_t \u2217 value )\n \n Download a camera setup from the memory.\n \n-4.2.4.41\n+4.3.4.41\n \n dc1394_memory_load()\n \n dc1394error_t dc1394_memory_load (\n dc1394camera_t \u2217 camera,\n uint32_t channel )\n \n Tells whether the writing of the camera setup in memory is finished or not.\n \n-Generated by Doxygen\n-\n-39\n-\n-\f40\n-\n-File Documentation\n-\n-4.2.4.42\n+4.3.4.42\n \n dc1394_memory_save()\n \n dc1394error_t dc1394_memory_save (\n dc1394camera_t \u2217 camera,\n uint32_t channel )\n \n Uploads a camera setup in the memory.\n Note that this operation can only be performed a certain number of times for a given camera, as it requires reprogramming of an EEPROM.\n \n-4.2.4.43\n+4.3.4.43\n \n dc1394_pio_get()\n \n dc1394error_t dc1394_pio_get (\n dc1394camera_t \u2217 camera,\n uint32_t \u2217 value )\n \n Gets the current quadlet at the PIO (input)\n \n-4.2.4.44\n+4.3.4.44\n \n dc1394_pio_set()\n \n dc1394error_t dc1394_pio_set (\n dc1394camera_t \u2217 camera,\n uint32_t value )\n \n Sends a quadlet on the PIO (output)\n+Generated by Doxygen\n \n-4.2.4.45\n+\f4.4 dc1394/conversions.h File Reference\n+\n+4.3.4.45\n+\n+43\n \n dc1394_software_trigger_get_power()\n \n dc1394error_t dc1394_software_trigger_get_power (\n dc1394camera_t \u2217 camera,\n dc1394switch_t \u2217 pwr )\n \n Gets the state of software trigger\n \n-4.2.4.46\n+4.3.4.46\n \n dc1394_software_trigger_set_power()\n \n dc1394error_t dc1394_software_trigger_set_power (\n dc1394camera_t \u2217 camera,\n dc1394switch_t pwr )\n \n Turn software trigger on or off\n \n-4.3\n+4.4\n \n dc1394/conversions.h File Reference\n \n functions to convert video formats\n \n #include <dc1394/log.h>\n \n-Generated by Doxygen\n-\n-\f4.3 dc1394/conversions.h File Reference\n-\n-41\n-\n Enumerations\n \u2022 enum dc1394bayer_method_t\n \u2022 enum dc1394stereo_method_t\n \n Functions\n \u2022 dc1394error_t dc1394_convert_to_YUV422 (uint8_t \u2217src, uint8_t \u2217dest, uint32_t width, uint32_t height,\n uint32_t byte_order, dc1394color_coding_t source_coding, uint32_t bits)\n@@ -4242,152 +4409,159 @@\n \u2022 dc1394error_t dc1394_bayer_decoding_16bit (const uint16_t \u2217bayer, uint16_t \u2217rgb, uint32_t width,\n uint32_t height, dc1394color_filter_t tile, dc1394bayer_method_t method, uint32_t bits)\n \u2022 dc1394error_t dc1394_convert_frames ( dc1394video_frame_t \u2217in, dc1394video_frame_t \u2217out)\n \u2022 dc1394error_t dc1394_debayer_frames ( dc1394video_frame_t \u2217in, dc1394video_frame_t \u2217out,\n dc1394bayer_method_t method)\n \u2022 dc1394error_t dc1394_deinterlace_stereo_frames ( dc1394video_frame_t \u2217in, dc1394video_frame\u2190_t \u2217out, dc1394stereo_method_t method)\n \n-4.3.1\n+Generated by Doxygen\n+\n+\f44\n+\n+File Documentation\n+\n+4.4.1\n \n Detailed Description\n \n functions to convert video formats\n Author\n Damien Douxchamps: coding\n Frederic Devernay: coding\n Peter Antoniac: documentation maintainer\n \n More details soon\n \n-4.3.2\n+4.4.2\n \n Enumeration Type Documentation\n \n-4.3.2.1\n+4.4.2.1\n \n dc1394bayer_method_t\n \n enum\n \n dc1394bayer_method_t\n \n A list of de-mosaicing techniques for Bayer-patterns.\n The speed of the techniques can vary greatly, as well as their quality.\n \n-4.3.2.2\n+4.4.2.2\n \n enum\n \n dc1394stereo_method_t\n \n dc1394stereo_method_t\n \n A list of known stereo-in-normal-video modes used by manufacturers like Point Grey Research and Videre Design.\n-Generated by Doxygen\n-\n-\f42\n \n-File Documentation\n-\n-4.3.3\n+4.4.3\n \n Function Documentation\n \n-4.3.3.1\n+4.4.3.1\n \n dc1394_bayer_decoding_16bit()\n \n dc1394error_t dc1394_bayer_decoding_16bit (\n const uint16_t \u2217 bayer,\n uint16_t \u2217 rgb,\n uint32_t width,\n uint32_t height,\n dc1394color_filter_t tile,\n dc1394bayer_method_t method,\n uint32_t bits )\n \n Perform de-mosaicing on an 16-bit image buffer\n \n-4.3.3.2\n+Generated by Doxygen\n+\n+\f4.4 dc1394/conversions.h File Reference\n+\n+4.4.3.2\n \n dc1394_bayer_decoding_8bit()\n \n dc1394error_t dc1394_bayer_decoding_8bit (\n const uint8_t \u2217 bayer,\n uint8_t \u2217 rgb,\n uint32_t width,\n uint32_t height,\n dc1394color_filter_t tile,\n dc1394bayer_method_t method )\n \n Perform de-mosaicing on an 8-bit image buffer\n \n-4.3.3.3\n+4.4.3.3\n \n dc1394_convert_frames()\n \n dc1394error_t dc1394_convert_frames (\n dc1394video_frame_t \u2217 in,\n dc1394video_frame_t \u2217 out )\n \n Converts the format of a video frame.\n To set the format of the output, simply set the values of the corresponding fields in the output frame\n \n-4.3.3.4\n+4.4.3.4\n \n dc1394_convert_to_MONO8()\n \n dc1394error_t dc1394_convert_to_MONO8 (\n uint8_t \u2217 src,\n uint8_t \u2217 dest,\n uint32_t width,\n uint32_t height,\n uint32_t byte_order,\n dc1394color_coding_t source_coding,\n uint32_t bits )\n \n Converts an image buffer to MONO8\n \n-Generated by Doxygen\n-\n-\f4.3 dc1394/conversions.h File Reference\n-\n-4.3.3.5\n-\n-43\n+4.4.3.5\n \n dc1394_convert_to_RGB8()\n \n dc1394error_t dc1394_convert_to_RGB8 (\n uint8_t \u2217 src,\n uint8_t \u2217 dest,\n uint32_t width,\n uint32_t height,\n uint32_t byte_order,\n dc1394color_coding_t source_coding,\n uint32_t bits )\n \n Converts an image buffer to RGB8\n \n-4.3.3.6\n+Generated by Doxygen\n+\n+45\n+\n+\f46\n+\n+4.4.3.6\n+\n+File Documentation\n \n dc1394_convert_to_YUV422()\n \n dc1394error_t dc1394_convert_to_YUV422 (\n uint8_t \u2217 src,\n uint8_t \u2217 dest,\n uint32_t width,\n uint32_t height,\n uint32_t byte_order,\n dc1394color_coding_t source_coding,\n uint32_t bits )\n \n Converts an image buffer to YUV422\n \n-4.3.3.7\n+4.4.3.7\n \n dc1394_debayer_frames()\n \n dc1394error_t dc1394_debayer_frames (\n dc1394video_frame_t \u2217 in,\n dc1394video_frame_t \u2217 out,\n dc1394bayer_method_t method )\n@@ -4405,45 +4579,42 @@\n be adjusted accordingly by this function. If there is no memory allocated to the image field, then\n ensure that out->image == NULL and out->allocated_image_bytes == 0\n \n method\n \n is the bayer method to interpolate the frame.\n \n-4.3.3.8\n+4.4.3.8\n \n dc1394_deinterlace_stereo()\n \n dc1394error_t dc1394_deinterlace_stereo (\n uint8_t \u2217 src,\n uint8_t \u2217 dest,\n-Generated by Doxygen\n-\n-\f44\n-\n-File Documentation\n-\n uint32_t width,\n uint32_t height )\n \n changes a 16bit stereo image (8bit/channel) into two 8bit images on top of each other\n \n-4.3.3.9\n+4.4.3.9\n \n dc1394_deinterlace_stereo_frames()\n \n dc1394error_t dc1394_deinterlace_stereo_frames (\n dc1394video_frame_t \u2217 in,\n dc1394video_frame_t \u2217 out,\n dc1394stereo_method_t method )\n \n De-interlacing of stereo data for cideo frames\n To set the format of the output, simply set the values of the corresponding fields in the output frame\n+Generated by Doxygen\n \n-4.4\n+\f4.5 dc1394/dc1394.h File Reference\n+\n+4.5\n \n dc1394/dc1394.h File Reference\n \n Main include file, which include all others.\n \n #include <dc1394/types.h>\n #include <dc1394/camera.h>\n@@ -4453,44 +4624,46 @@\n #include <dc1394/format7.h>\n #include <dc1394/iso.h>\n #include <dc1394/log.h>\n #include <dc1394/register.h>\n #include <dc1394/video.h>\n #include <dc1394/utils.h>\n \n-4.4.1\n+4.5.1\n \n Detailed Description\n \n Main include file, which include all others.\n More details soon\n \n-4.5\n+4.6\n \n dc1394/format7.h File Reference\n \n Functions to control Format_7 (aka scalable format, ROI)\n \n #include <dc1394/log.h>\n #include <dc1394/video.h>\n \n-Generated by Doxygen\n-\n-\f4.5 dc1394/format7.h File Reference\n-\n-45\n-\n Data Structures\n \u2022 struct __dc1394format7mode_t\n \u2022 struct __dc1394format7modeset_t\n \n Typedefs\n \u2022 typedef struct __dc1394format7mode_t dc1394format7mode_t\n \u2022 typedef struct __dc1394format7modeset_t dc1394format7modeset_t\n \n+Generated by Doxygen\n+\n+47\n+\n+\f48\n+\n+File Documentation\n+\n Functions\n \u2022 dc1394error_t dc1394_format7_get_max_image_size ( dc1394camera_t \u2217camera, dc1394video_\u2190mode_t video_mode, uint32_t \u2217h_size, uint32_t \u2217v_size)\n \u2022 dc1394error_t dc1394_format7_get_unit_size ( dc1394camera_t \u2217camera, dc1394video_mode_\u2190t video_mode, uint32_t \u2217h_unit, uint32_t \u2217v_unit)\n \u2022 dc1394error_t dc1394_format7_get_image_size ( dc1394camera_t \u2217camera, dc1394video_mode_t\n video_mode, uint32_t \u2217width, uint32_t \u2217height)\n \u2022 dc1394error_t dc1394_format7_set_image_size ( dc1394camera_t \u2217camera, dc1394video_mode_t\n video_mode, uint32_t width, uint32_t height)\n@@ -4517,250 +4690,253 @@\n video_mode, uint32_t \u2217data_depth)\n \u2022 dc1394error_t dc1394_format7_get_frame_interval ( dc1394camera_t \u2217camera, dc1394video_\u2190mode_t video_mode, float \u2217interval)\n \u2022 dc1394error_t dc1394_format7_get_pixel_number ( dc1394camera_t \u2217camera, dc1394video_mode\u2190_t video_mode, uint32_t \u2217pixnum)\n \u2022 dc1394error_t dc1394_format7_get_total_bytes ( dc1394camera_t \u2217camera, dc1394video_mode_t\n video_mode, uint64_t \u2217total_bytes)\n \u2022 dc1394error_t dc1394_format7_get_modeset ( dc1394camera_t \u2217camera, dc1394format7modeset_t\n \u2217info)\n-Generated by Doxygen\n-\n-\f46\n-\n-File Documentation\n \u2022 dc1394error_t dc1394_format7_get_mode_info ( dc1394camera_t \u2217camera, dc1394video_mode_\u2190t video_mode, dc1394format7mode_t \u2217f7_mode)\n \u2022 dc1394error_t dc1394_format7_set_roi ( dc1394camera_t \u2217camera, dc1394video_mode_t video\u2190_mode, dc1394color_coding_t color_coding, int32_t packet_size, int32_t left, int32_t top, int32_t width,\n int32_t height)\n \u2022 dc1394error_t dc1394_format7_get_roi ( dc1394camera_t \u2217camera, dc1394video_mode_t video_\u2190mode, dc1394color_coding_t \u2217color_coding, uint32_t \u2217packet_size, uint32_t \u2217left, uint32_t \u2217top, uint32_t\n \u2217width, uint32_t \u2217height)\n \n-4.5.1\n+4.6.1\n \n Detailed Description\n \n Functions to control Format_7 (aka scalable format, ROI)\n More details soon\n+Generated by Doxygen\n \n-4.5.2\n+\f4.6 dc1394/format7.h File Reference\n+\n+4.6.2\n \n Typedef Documentation\n \n-4.5.2.1\n+4.6.2.1\n \n dc1394format7mode_t\n \n typedef struct\n \n __dc1394format7mode_t\n \n+49\n+\n dc1394format7mode_t\n \n A struct containing information about a mode of Format_7, the scalable image format.\n \n-4.5.2.2\n+4.6.2.2\n \n dc1394format7modeset_t\n \n typedef struct\n \n __dc1394format7modeset_t\n \n dc1394format7modeset_t\n \n A struct containing the list of Format_7 modes. FIXME: this may become very big if format_7 pages are used in\n IIDC 1.32. It would be better to use a \"num\" and an allocated list.\n \n-4.5.3\n+4.6.3\n \n Function Documentation\n \n-4.5.3.1\n+4.6.3.1\n \n dc1394_format7_get_color_coding()\n \n dc1394error_t dc1394_format7_get_color_coding (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n dc1394color_coding_t \u2217 color_coding )\n \n Gets the current color coding\n \n-4.5.3.2\n+4.6.3.2\n \n dc1394_format7_get_color_codings()\n \n dc1394error_t dc1394_format7_get_color_codings (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n dc1394color_codings_t \u2217 codings )\n \n Gets the list of color codings available for this mode\n-Generated by Doxygen\n \n-\f4.5 dc1394/format7.h File Reference\n-\n-4.5.3.3\n+4.6.3.3\n \n dc1394_format7_get_color_filter()\n \n dc1394error_t dc1394_format7_get_color_filter (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n dc1394color_filter_t \u2217 color_filter )\n \n Gets the current color filter\n \n-4.5.3.4\n+Generated by Doxygen\n+\n+\f50\n+\n+4.6.3.4\n+\n+File Documentation\n \n dc1394_format7_get_data_depth()\n \n dc1394error_t dc1394_format7_get_data_depth (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n uint32_t \u2217 data_depth )\n \n Gets the data depth (e.g. 12, 13, 14 bits/pixel)\n \n-4.5.3.5\n+4.6.3.5\n \n dc1394_format7_get_frame_interval()\n \n dc1394error_t dc1394_format7_get_frame_interval (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n float \u2217 interval )\n \n Gets the frame interval in float format\n \n-4.5.3.6\n+4.6.3.6\n \n dc1394_format7_get_image_position()\n \n dc1394error_t dc1394_format7_get_image_position (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n uint32_t \u2217 left,\n uint32_t \u2217 top )\n \n Gets the current image position\n \n-4.5.3.7\n+4.6.3.7\n \n dc1394_format7_get_image_size()\n \n dc1394error_t dc1394_format7_get_image_size (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n uint32_t \u2217 width,\n uint32_t \u2217 height )\n \n Gets the current image size.\n \n-Generated by Doxygen\n-\n-47\n-\n-\f48\n-\n-4.5.3.8\n-\n-File Documentation\n+4.6.3.8\n \n dc1394_format7_get_max_image_size()\n \n dc1394error_t dc1394_format7_get_max_image_size (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n uint32_t \u2217 h_size,\n uint32_t \u2217 v_size )\n \n Gets the maximal image size for a given mode.\n \n-4.5.3.9\n+Generated by Doxygen\n+\n+\f4.6 dc1394/format7.h File Reference\n+\n+4.6.3.9\n+\n+51\n \n dc1394_format7_get_mode_info()\n \n dc1394error_t dc1394_format7_get_mode_info (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n dc1394format7mode_t \u2217 f7_mode )\n \n Gets the properties of a Format_7 mode\n \n-4.5.3.10\n+4.6.3.10\n \n dc1394_format7_get_modeset()\n \n dc1394error_t dc1394_format7_get_modeset (\n dc1394camera_t \u2217 camera,\n dc1394format7modeset_t \u2217 info )\n \n Gets the properties of all Format_7 modes supported by the camera.\n \n-4.5.3.11\n+4.6.3.11\n \n dc1394_format7_get_packet_parameters()\n \n dc1394error_t dc1394_format7_get_packet_parameters (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n uint32_t \u2217 unit_bytes,\n uint32_t \u2217 max_bytes )\n \n Get the parameters of the packet size: its maximal size and its unit size. The packet size is always a multiple of the\n unit bytes and cannot be zero.\n \n-4.5.3.12\n+4.6.3.12\n \n dc1394_format7_get_packet_size()\n \n dc1394error_t dc1394_format7_get_packet_size (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n uint32_t \u2217 packet_size )\n \n Gets the current packet size\n \n-Generated by Doxygen\n-\n-\f4.5 dc1394/format7.h File Reference\n-\n-4.5.3.13\n+4.6.3.13\n \n dc1394_format7_get_packets_per_frame()\n \n dc1394error_t dc1394_format7_get_packets_per_frame (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n uint32_t \u2217 ppf )\n \n Gets the number of packets per frame.\n \n-4.5.3.14\n+Generated by Doxygen\n+\n+\f52\n+\n+4.6.3.14\n+\n+File Documentation\n \n dc1394_format7_get_pixel_number()\n \n dc1394error_t dc1394_format7_get_pixel_number (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n uint32_t \u2217 pixnum )\n \n Gets the number of pixels per image frame\n \n-4.5.3.15\n+4.6.3.15\n \n dc1394_format7_get_recommended_packet_size()\n \n dc1394error_t dc1394_format7_get_recommended_packet_size (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n uint32_t \u2217 packet_size )\n \n Gets the recommended packet size. Ignore if zero.\n \n-4.5.3.16\n+4.6.3.16\n \n dc1394_format7_get_roi()\n \n dc1394error_t dc1394_format7_get_roi (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n dc1394color_coding_t \u2217 color_coding,\n@@ -4768,111 +4944,109 @@\n uint32_t \u2217 left,\n uint32_t \u2217 top,\n uint32_t \u2217 width,\n uint32_t \u2217 height )\n \n Joint function that fully gets a certain ROI taking all parameters into account.\n \n-4.5.3.17\n+4.6.3.17\n \n dc1394_format7_get_total_bytes()\n \n dc1394error_t dc1394_format7_get_total_bytes (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n uint64_t \u2217 total_bytes )\n \n Get the total number of bytes per frame. This includes padding (to reach an entire number of packets)\n \n-Generated by Doxygen\n-\n-49\n-\n-\f50\n-\n-4.5.3.18\n-\n-File Documentation\n+4.6.3.18\n \n dc1394_format7_get_unit_position()\n \n dc1394error_t dc1394_format7_get_unit_position (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n uint32_t \u2217 h_unit_pos,\n uint32_t \u2217 v_unit_pos )\n \n Gets the unit positions for a given mode. The image position can only be a multiple of the unit position (zero is\n acceptable).\n+Generated by Doxygen\n+\n+\f4.6 dc1394/format7.h File Reference\n \n-4.5.3.19\n+4.6.3.19\n+\n+53\n \n dc1394_format7_get_unit_size()\n \n dc1394error_t dc1394_format7_get_unit_size (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n uint32_t \u2217 h_unit,\n uint32_t \u2217 v_unit )\n \n Gets the unit sizes for a given mode. The image size can only be a multiple of the unit size, and cannot be smaller\n than it.\n \n-4.5.3.20\n+4.6.3.20\n \n dc1394_format7_set_color_coding()\n \n dc1394error_t dc1394_format7_set_color_coding (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n dc1394color_coding_t color_coding )\n \n Sets the current color coding\n \n-4.5.3.21\n+4.6.3.21\n \n dc1394_format7_set_image_position()\n \n dc1394error_t dc1394_format7_set_image_position (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n uint32_t left,\n uint32_t top )\n \n Sets the current image position\n \n-4.5.3.22\n+4.6.3.22\n \n dc1394_format7_set_image_size()\n \n dc1394error_t dc1394_format7_set_image_size (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n uint32_t width,\n uint32_t height )\n \n Sets the current image size\n-Generated by Doxygen\n \n-\f4.6 dc1394/iso.h File Reference\n-\n-4.5.3.23\n-\n-51\n+4.6.3.23\n \n dc1394_format7_set_packet_size()\n \n dc1394error_t dc1394_format7_set_packet_size (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n uint32_t packet_size )\n \n Sets the current packet size\n \n-4.5.3.24\n+Generated by Doxygen\n+\n+\f54\n+\n+File Documentation\n+\n+4.6.3.24\n \n dc1394_format7_set_roi()\n \n dc1394error_t dc1394_format7_set_roi (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n dc1394color_coding_t color_coding,\n@@ -4881,15 +5055,15 @@\n int32_t top,\n int32_t width,\n int32_t height )\n \n Joint function that fully sets a certain ROI taking all parameters into account. Note that this function does not\n SWITCH to the video mode passed as argument, it mearly sets it\n \n-4.6\n+4.7\n \n dc1394/iso.h File Reference\n \n Functions to manually manage the ISO resources (channels and bandwidth)\n \n #include <dc1394/log.h>\n \n@@ -4898,59 +5072,61 @@\n \u2022 dc1394error_t dc1394_iso_allocate_channel ( dc1394camera_t \u2217camera, uint64_t channels_allowed, int\n \u2217channel)\n \u2022 dc1394error_t dc1394_iso_release_channel ( dc1394camera_t \u2217camera, int channel)\n \u2022 dc1394error_t dc1394_iso_allocate_bandwidth ( dc1394camera_t \u2217camera, int bandwidth_units)\n \u2022 dc1394error_t dc1394_iso_release_bandwidth ( dc1394camera_t \u2217camera, int bandwidth_units)\n \u2022 dc1394error_t dc1394_iso_release_all ( dc1394camera_t \u2217camera)\n \n-4.6.1\n+4.7.1\n \n Detailed Description\n \n Functions to manually manage the ISO resources (channels and bandwidth)\n Author\n Damien Douxchamps: coding\n Peter Antoniac: documentation maintainer\n More details soon\n-Generated by Doxygen\n-\n-\f52\n \n-File Documentation\n-\n-4.6.2\n+4.7.2\n \n Function Documentation\n \n-4.6.2.1\n+4.7.2.1\n \n dc1394_iso_allocate_bandwidth()\n \n dc1394error_t dc1394_iso_allocate_bandwidth (\n dc1394camera_t \u2217 camera,\n int bandwidth_units )\n \n dc1394_iso_allocate_bandwidth:\n+\n+Generated by Doxygen\n+\n+\f4.7 dc1394/iso.h File Reference\n+\n+55\n+\n Parameters\n camera\n bandwidth_units\n \n A camera handle.\n The number of isochronous bandwidth units to allocate.\n \n Allocates isochronous bandwidth. This functions allocates bandwidth in addition to any previous allocations. It\n may be called multiple times. The bandwidth is automatically re-allocated if there is a bus reset. The bandwidth is\n automatically released if this camera is freed or the application shuts down prematurely. If the bandwidth needs to\n-persist beyond the lifetime of this application, call dc1394_iso_set_persist() ( p. 54) first.\n+persist beyond the lifetime of this application, call dc1394_iso_set_persist() ( p. 57) first.\n \n Returns\n DC1394_SUCCESS if the operation succeeded. DC1394_FUNCTION_NOT_SUPPORTED if the current\n driver/platform does not allow bandwidth allocation. DC1394_NO_BANDWIDTH if there is not enough available bandwidth to support the allocation. In this case, no bandwidth is allocated.\n \n-4.6.2.2\n+4.7.2.2\n \n dc1394_iso_allocate_channel()\n \n dc1394error_t dc1394_iso_allocate_channel (\n dc1394camera_t \u2217 camera,\n uint64_t channels_allowed,\n int \u2217 channel )\n@@ -4970,29 +5146,28 @@\n channel\n \n The allocated channel number is returned here.\n \n Allocates an isochronous channel. This function may be called multiple times, each time allocating an additional\n channel. The channel is automatically re-allocated if there is a bus reset. The channel is automatically released\n when this dc1394camera_t is freed or if the application shuts down prematurely. If the channel needs to persist\n-beyond the lifetime of this application, call dc1394_iso_set_persist() ( p. 54) first. Note that this function does not\n-\n-Generated by Doxygen\n-\n-\f4.6 dc1394/iso.h File Reference\n-\n-53\n-\n+beyond the lifetime of this application, call dc1394_iso_set_persist() ( p. 57) first. Note that this function does not\n automatically program camera to use the allocated channel for isochronous streaming. You must do that manually\n using dc1394_video_set_iso_channel() ( p. 95).\n \n Returns\n DC1394_SUCCESS if the operation succeeded. The allocated channel is stored in channel. DC1394_\u2190FUNCTION_NOT_SUPPORTED if the current driver/platform does not allow channel allocation. DC1394_\u2190NO_ISO_CHANNEL if none of the requested channels are available.\n \n-4.6.2.3\n+Generated by Doxygen\n+\n+\f56\n+\n+File Documentation\n+\n+4.7.2.3\n \n dc1394_iso_release_all()\n \n dc1394error_t dc1394_iso_release_all (\n dc1394camera_t \u2217 camera )\n \n dc1394_iso_release_all:\n@@ -5000,21 +5175,21 @@\n camera\n \n A camera handle.\n \n Releases all channels and bandwidth that have been previously allocated for this dc1394camera_t. Note that this\n information can only be tracked per process, and there is no knowledge of allocations for this camera by previous\n processes. To release resources in such a case, the manual release functions dc1394_iso_release_channel()\n-( p. 54) and dc1394_iso_release_bandwidth() ( p. 53) must be used.\n+( p. 56) and dc1394_iso_release_bandwidth() ( p. 56) must be used.\n \n Returns\n DC1394_SUCCESS if the operation succeeded. DC1394_FAILURE if some resources were not able to be\n released.\n \n-4.6.2.4\n+4.7.2.4\n \n dc1394_iso_release_bandwidth()\n \n dc1394error_t dc1394_iso_release_bandwidth (\n dc1394camera_t \u2217 camera,\n int bandwidth_units )\n \n@@ -5027,49 +5202,49 @@\n The number of isochronous bandwidth units to free.\n \n Releases previously allocated isochronous bandwidth. Each dc1394camera_t keeps track of a running total of\n bandwidth that has been allocated. Released bandwidth is subtracted from this total for the sake of automatic reallocation and automatic release on shutdown. It is also acceptable for a camera to release more bandwidth than\n it has allocated (to clean up for another process for example). In this case, the running total of bandwidth is not\n affected. It is acceptable to release more bandwidth than is allocated in total for the bus. In this case, all bandwidth\n is released and the function succeeds.\n-\n-Generated by Doxygen\n-\n-\f54\n-\n-File Documentation\n-\n Returns\n DC1394_SUCCESS if the operation succeeded. DC1394_FUNCTION_NOT_SUPPORTED if the current\n driver/platform does not allow bandwidth release.\n \n-4.6.2.5\n+4.7.2.5\n \n dc1394_iso_release_channel()\n \n dc1394error_t dc1394_iso_release_channel (\n dc1394camera_t \u2217 camera,\n int channel )\n \n dc1394_iso_release_channel:\n+\n+Generated by Doxygen\n+\n+\f4.8 dc1394/log.h File Reference\n+\n+57\n+\n Parameters\n camera\n channel\n \n A camera handle.\n The channel number to release.\n \n Releases a previously allocated channel. It is acceptable to release channels that were allocated by a different\n process or host. If attempting to release a channel that is already released, the function will succeed.\n \n Returns\n DC1394_SUCCESS if the operation succeeded. DC1394_FUNCTION_NOT_SUPPORTED if the current\n driver/platform does not allow channel release.\n \n-4.6.2.6\n+4.7.2.6\n \n dc1394_iso_set_persist()\n \n dc1394error_t dc1394_iso_set_persist (\n dc1394camera_t \u2217 camera )\n \n dc1394_iso_set_persist\n@@ -5078,204 +5253,30 @@\n \n A camera handle.\n \n Calling this function will cause isochronous channel and bandwidth allocations to persist beyond the lifetime of\n this dc1394camera_t instance. Normally (when this function is not called), any allocations would be automatically\n released upon freeing this camera or a premature shutdown of the application (if possible). For this function to be\n used, it must be called prior to any allocations or an error will be returned.\n+\n Returns\n DC1394_SUCCESS if the operation succeeded. DC1394_FUNCTION_NOT_SUPPORTED if the current platform/driver does not allow persistent allocations.\n \n-4.7\n-\n-dc1394/capture.h File Reference\n-\n-Capture functions.\n-Generated by Doxygen\n-\n-\f4.7 dc1394/capture.h File Reference\n-\n-55\n-\n-#include <dc1394/log.h>\n-#include <dc1394/video.h>\n-\n-Macros\n-\u2022 #define DC1394_CAPTURE_FLAGS_CHANNEL_ALLOC 0x00000001U\n-\n-Typedefs\n-\u2022 typedef void(\u2217 dc1394capture_callback_t) ( dc1394camera_t \u2217, void \u2217)\n-\n-Enumerations\n-\u2022 enum dc1394capture_policy_t\n-\n-Functions\n-\u2022 dc1394error_t dc1394_capture_setup ( dc1394camera_t \u2217camera, uint32_t num_dma_buffers, uint32_t\n-flags)\n-\u2022 dc1394error_t dc1394_capture_stop ( dc1394camera_t \u2217camera)\n-\u2022 int dc1394_capture_get_fileno ( dc1394camera_t \u2217camera)\n-\u2022 dc1394error_t dc1394_capture_dequeue ( dc1394camera_t \u2217camera, dc1394capture_policy_t policy,\n-dc1394video_frame_t \u2217\u2217frame)\n-\u2022 dc1394error_t dc1394_capture_enqueue ( dc1394camera_t \u2217camera, dc1394video_frame_t \u2217frame)\n-\u2022 dc1394bool_t dc1394_capture_is_frame_corrupt ( dc1394camera_t \u2217camera, dc1394video_frame_t\n-\u2217frame)\n-\u2022 void dc1394_capture_set_callback ( dc1394camera_t \u2217camera, dc1394capture_callback_t callback,\n-void \u2217user_data)\n-\n-4.7.1\n-\n-Detailed Description\n-\n-Capture functions.\n-Author\n-Damien Douxchamps: coding\n-Peter Antoniac: documentation maintainer\n-\n-More details soon\n-\n-4.7.2\n-\n-Macro Definition Documentation\n-\n-4.7.2.1\n-\n-DC1394_CAPTURE_FLAGS_CHANNEL_ALLOC\n-\n-#define DC1394_CAPTURE_FLAGS_CHANNEL_ALLOC 0x00000001U\n-\n-Capture flags. Currently limited to switching automatic functions on/off: channel allocation, bandwidth allocation\n-and automatic starting of ISO transmission\n-Generated by Doxygen\n-\n-\f56\n-\n-File Documentation\n-\n-4.7.3\n-\n-Typedef Documentation\n-\n-4.7.3.1\n-\n-dc1394capture_callback_t\n-\n-typedef void(\u2217 dc1394capture_callback_t) ( dc1394camera_t \u2217, void \u2217)\n-\n-typedef for the callback param for dc1394_capture_set_callback\n-\n-4.7.4\n-\n-Enumeration Type Documentation\n-\n-4.7.4.1\n-\n-dc1394capture_policy_t\n-\n-enum\n-\n-dc1394capture_policy_t\n-\n-The capture policy.\n-Can be blocking (wait for a frame forever) or polling (returns if no frames is in the ring buffer)\n-\n-4.7.5\n-\n-Function Documentation\n-\n-4.7.5.1\n-\n-dc1394_capture_dequeue()\n-\n-dc1394error_t dc1394_capture_dequeue (\n-dc1394camera_t \u2217 camera,\n-dc1394capture_policy_t policy,\n-dc1394video_frame_t \u2217\u2217 frame )\n-\n-Captures a video frame. The returned struct contains the image buffer, among others. This image buffer SHALL\n-NOT be freed, as it represents an area in the memory that belongs to the system.\n-\n-4.7.5.2\n-\n-dc1394_capture_enqueue()\n-\n-dc1394error_t dc1394_capture_enqueue (\n-dc1394camera_t \u2217 camera,\n-dc1394video_frame_t \u2217 frame )\n-\n-Returns a frame to the ring buffer once it has been used.\n-\n-4.7.5.3\n-\n-dc1394_capture_get_fileno()\n-\n-int dc1394_capture_get_fileno (\n-dc1394camera_t \u2217 camera )\n-\n-Gets a file descriptor to be used for select(). Must be called after dc1394_capture_setup() (p. 57).\n-\n-Generated by Doxygen\n-\n-\f4.8 dc1394/log.h File Reference\n-\n-4.7.5.4\n-\n-57\n-\n-dc1394_capture_is_frame_corrupt()\n-\n-dc1394bool_t dc1394_capture_is_frame_corrupt (\n-dc1394camera_t \u2217 camera,\n-dc1394video_frame_t \u2217 frame )\n-\n-Returns DC1394_TRUE if the given frame (previously dequeued) has been detected to be corrupt (missing data,\n-corrupted data, overrun buffer, etc.). Note that certain types of corruption may go undetected in which case\n-DC1394_FALSE will be returned. The ability to detect corruption also varies between platforms. Note that corrupt frames still need to be enqueued with dc1394_capture_enqueue() (p. 56) when no longer needed by the user.\n-\n-4.7.5.5\n-\n-dc1394_capture_set_callback()\n-\n-void dc1394_capture_set_callback (\n-dc1394camera_t \u2217 camera,\n-dc1394capture_callback_t callback,\n-void \u2217 user_data )\n-\n-Set a callback if supported by the platform (OS X only for now).\n-\n-4.7.5.6\n-\n-dc1394_capture_setup()\n-\n-dc1394error_t dc1394_capture_setup (\n-dc1394camera_t \u2217 camera,\n-uint32_t num_dma_buffers,\n-uint32_t flags )\n-\n-Setup the capture, using a ring buffer of a certain size (num_dma_buffers) and certain options (flags)\n-\n-4.7.5.7\n-\n-dc1394_capture_stop()\n-\n-dc1394error_t dc1394_capture_stop (\n-dc1394camera_t \u2217 camera )\n-\n-Stop the capture\n-\n 4.8\n \n dc1394/log.h File Reference\n \n Functions to log errors, warning and debug messages.\n \n #include <dc1394/dc1394.h>\n \n Enumerations\n \u2022 enum dc1394error_t\n \u2022 enum dc1394log_t\n+\n Generated by Doxygen\n \n \f58\n \n File Documentation\n \n Functions\n@@ -8011,107 +8012,107 @@\n dc1394_reset_bus, 28\n dc1394camera_list_t, 26\n dc1394camera_t, 26\n dc1394iidc_version_t, 26\n dc1394phy_delay_t, 26\n dc1394power_class_t, 26\n capture.h\n-dc1394_capture_dequeue, 56\n-dc1394_capture_enqueue, 56\n+dc1394_capture_dequeue, 30\n+dc1394_capture_enqueue, 30\n DC1394_CAPTURE_FLAGS_CHANNEL_ALLOC,\n-55\n-dc1394_capture_get_fileno, 56\n-dc1394_capture_is_frame_corrupt, 56\n-dc1394_capture_set_callback, 57\n-dc1394_capture_setup, 57\n-dc1394_capture_stop, 57\n-dc1394capture_callback_t, 56\n-dc1394capture_policy_t, 56\n+30\n+dc1394_capture_get_fileno, 31\n+dc1394_capture_is_frame_corrupt, 31\n+dc1394_capture_set_callback, 31\n+dc1394_capture_setup, 31\n+dc1394_capture_stop, 31\n+dc1394capture_callback_t, 30\n+dc1394capture_policy_t, 30\n control.h\n-dc1394_camera_reset, 32\n-dc1394_camera_set_power, 32\n-dc1394_external_trigger_get_mode, 33\n-dc1394_external_trigger_get_polarity, 33\n-dc1394_external_trigger_get_power, 33\n-dc1394_external_trigger_get_source, 33\n+dc1394_camera_reset, 35\n+dc1394_camera_set_power, 35\n+dc1394_external_trigger_get_mode, 35\n+dc1394_external_trigger_get_polarity, 35\n+dc1394_external_trigger_get_power, 36\n+dc1394_external_trigger_get_source, 36\n dc1394_external_trigger_get_supported_sources,\n-33\n+36\n \n INDEX\n \n-dc1394_external_trigger_has_polarity, 33\n-dc1394_external_trigger_set_mode, 34\n-dc1394_external_trigger_set_polarity, 34\n-dc1394_external_trigger_set_power, 34\n-dc1394_external_trigger_set_source, 34\n-dc1394_feature_get, 34\n-dc1394_feature_get_absolute_boundaries, 34\n-dc1394_feature_get_absolute_control, 35\n-dc1394_feature_get_absolute_value, 35\n-dc1394_feature_get_all, 35\n-dc1394_feature_get_boundaries, 35\n-dc1394_feature_get_mode, 35\n-dc1394_feature_get_modes, 36\n-dc1394_feature_get_power, 36\n-dc1394_feature_get_value, 36\n-dc1394_feature_has_absolute_control, 36\n-dc1394_feature_is_present, 36\n-dc1394_feature_is_readable, 36\n-dc1394_feature_is_switchable, 37\n-dc1394_feature_print, 37\n-dc1394_feature_print_all, 37\n-dc1394_feature_set_absolute_control, 37\n-dc1394_feature_set_absolute_value, 37\n-dc1394_feature_set_mode, 37\n-dc1394_feature_set_power, 38\n-dc1394_feature_set_value, 38\n-dc1394_feature_temperature_get_value, 38\n-dc1394_feature_temperature_set_value, 38\n-dc1394_feature_whitebalance_get_value, 38\n-dc1394_feature_whitebalance_set_value, 38\n-dc1394_feature_whiteshading_get_value, 39\n-dc1394_feature_whiteshading_set_value, 39\n-dc1394_memory_busy, 39\n-dc1394_memory_load, 39\n-dc1394_memory_save, 39\n-dc1394_pio_get, 40\n-dc1394_pio_set, 40\n-dc1394_software_trigger_get_power, 40\n-dc1394_software_trigger_set_power, 40\n-dc1394feature_info_t, 31\n-dc1394feature_mode_t, 32\n-dc1394feature_t, 32\n-dc1394featureset_t, 31\n-dc1394trigger_mode_t, 32\n-dc1394trigger_polarity_t, 32\n-dc1394trigger_source_t, 32\n+dc1394_external_trigger_has_polarity, 36\n+dc1394_external_trigger_set_mode, 36\n+dc1394_external_trigger_set_polarity, 36\n+dc1394_external_trigger_set_power, 37\n+dc1394_external_trigger_set_source, 37\n+dc1394_feature_get, 37\n+dc1394_feature_get_absolute_boundaries, 37\n+dc1394_feature_get_absolute_control, 37\n+dc1394_feature_get_absolute_value, 37\n+dc1394_feature_get_all, 38\n+dc1394_feature_get_boundaries, 38\n+dc1394_feature_get_mode, 38\n+dc1394_feature_get_modes, 38\n+dc1394_feature_get_power, 38\n+dc1394_feature_get_value, 38\n+dc1394_feature_has_absolute_control, 39\n+dc1394_feature_is_present, 39\n+dc1394_feature_is_readable, 39\n+dc1394_feature_is_switchable, 39\n+dc1394_feature_print, 39\n+dc1394_feature_print_all, 39\n+dc1394_feature_set_absolute_control, 40\n+dc1394_feature_set_absolute_value, 40\n+dc1394_feature_set_mode, 40\n+dc1394_feature_set_power, 40\n+dc1394_feature_set_value, 40\n+dc1394_feature_temperature_get_value, 40\n+dc1394_feature_temperature_set_value, 41\n+dc1394_feature_whitebalance_get_value, 41\n+dc1394_feature_whitebalance_set_value, 41\n+dc1394_feature_whiteshading_get_value, 41\n+dc1394_feature_whiteshading_set_value, 41\n+dc1394_memory_busy, 42\n+dc1394_memory_load, 42\n+dc1394_memory_save, 42\n+dc1394_pio_get, 42\n+dc1394_pio_set, 42\n+dc1394_software_trigger_get_power, 42\n+dc1394_software_trigger_set_power, 43\n+dc1394feature_info_t, 34\n+dc1394feature_mode_t, 34\n+dc1394feature_t, 34\n+dc1394featureset_t, 34\n+dc1394trigger_mode_t, 34\n+dc1394trigger_polarity_t, 35\n+dc1394trigger_source_t, 35\n conversions.h\n-dc1394_bayer_decoding_16bit, 42\n-dc1394_bayer_decoding_8bit, 42\n-dc1394_convert_frames, 42\n-dc1394_convert_to_MONO8, 42\n-dc1394_convert_to_RGB8, 42\n-dc1394_convert_to_YUV422, 43\n-dc1394_debayer_frames, 43\n-dc1394_deinterlace_stereo, 43\n-dc1394_deinterlace_stereo_frames, 44\n-dc1394bayer_method_t, 41\n-dc1394stereo_method_t, 41\n+dc1394_bayer_decoding_16bit, 44\n+dc1394_bayer_decoding_8bit, 44\n+dc1394_convert_frames, 45\n+dc1394_convert_to_MONO8, 45\n+dc1394_convert_to_RGB8, 45\n+dc1394_convert_to_YUV422, 45\n+dc1394_debayer_frames, 46\n+dc1394_deinterlace_stereo, 46\n+dc1394_deinterlace_stereo_frames, 46\n+dc1394bayer_method_t, 44\n+dc1394stereo_method_t, 44\n \n Generated by Doxygen\n \n \fINDEX\n \n dc1394/camera.h, 25\n-dc1394/capture.h, 54\n-dc1394/control.h, 29\n-dc1394/conversions.h, 40\n-dc1394/dc1394.h, 44\n-dc1394/format7.h, 44\n-dc1394/iso.h, 51\n+dc1394/capture.h, 29\n+dc1394/control.h, 32\n+dc1394/conversions.h, 43\n+dc1394/dc1394.h, 47\n+dc1394/format7.h, 47\n+dc1394/iso.h, 54\n dc1394/log.h, 57\n dc1394/register.h, 60\n dc1394/types.h, 64\n dc1394/utils.h, 65\n dc1394/vendor/avt.h, 68\n dc1394/vendor/basler.h, 81\n dc1394/vendor/basler_sff.h, 83\n@@ -8224,15 +8225,15 @@\n dc1394_avt_set_test_images\n \n \f100\n \n INDEX\n \n avt.h, 80\n-conversions.h, 42\n+conversions.h, 44\n dc1394_avt_set_timebase\n dc1394_camera_enumerate\n avt.h, 80\n camera.h, 27\n dc1394_avt_set_trigger_delay\n dc1394_camera_free\n avt.h, 80\n@@ -8260,228 +8261,228 @@\n dc1394_basler_sff_chunk_iterate_init\n dc1394_camera_print_info\n basler.h, 82\n camera.h, 28\n DC1394_BASLER_SFF_CRC_CHECKSUM\n dc1394_camera_reset\n basler_sff.h, 85\n-control.h, 32\n+control.h, 35\n DC1394_BASLER_SFF_CYCLE_TIME_STAMP\n dc1394_camera_set_broadcast\n basler_sff.h, 85\n camera.h, 28\n DC1394_BASLER_SFF_DCAM_VALUES\n dc1394_camera_set_power\n basler_sff.h, 85\n-control.h, 32\n+control.h, 35\n DC1394_BASLER_SFF_EXTENDED_DATA_STREAM\n dc1394_capture_dequeue\n basler_sff.h, 85\n-capture.h, 56\n+capture.h, 30\n DC1394_BASLER_SFF_EXTENDED_VERSION_INFO dc1394_capture_enqueue\n basler_sff.h, 86\n-capture.h, 56\n+capture.h, 30\n dc1394_basler_sff_feature_enable\n DC1394_CAPTURE_FLAGS_CHANNEL_ALLOC\n basler.h, 82\n-capture.h, 55\n+capture.h, 30\n dc1394_basler_sff_feature_is_available\n dc1394_capture_get_fileno\n basler.h, 82\n-capture.h, 56\n+capture.h, 31\n dc1394_basler_sff_feature_is_enabled\n dc1394_capture_is_frame_corrupt\n basler.h, 82\n-capture.h, 56\n+capture.h, 31\n dc1394_basler_sff_feature_print\n dc1394_capture_set_callback\n basler.h, 82\n-capture.h, 57\n+capture.h, 31\n dc1394_basler_sff_feature_print_all\n dc1394_capture_setup\n basler.h, 82\n-capture.h, 57\n+capture.h, 31\n DC1394_BASLER_SFF_FRAME_COUNTER\n dc1394_capture_stop\n basler_sff.h, 85\n-capture.h, 57\n+capture.h, 31\n dc1394_basler_sff_is_available\n dc1394_checksum_crc16\n basler.h, 83\n utils.h, 66\n DC1394_BASLER_SFF_LOOKUP_TABLE\n dc1394_convert_frames\n basler_sff.h, 86\n-conversions.h, 42\n+conversions.h, 45\n DC1394_BASLER_SFF_OUTPUT_PORT_0_CONFIGURATION\n dc1394_convert_to_MONO8\n basler_sff.h, 86\n-conversions.h, 42\n+conversions.h, 45\n DC1394_BASLER_SFF_OUTPUT_PORT_1_CONFIGURATION\n dc1394_convert_to_RGB8\n basler_sff.h, 86\n-conversions.h, 42\n+conversions.h, 45\n DC1394_BASLER_SFF_OUTPUT_PORT_2_CONFIGURATION\n dc1394_convert_to_YUV422\n basler_sff.h, 86\n-conversions.h, 43\n+conversions.h, 45\n DC1394_BASLER_SFF_OUTPUT_PORT_3_CONFIGURATION\n dc1394_debayer_frames\n basler_sff.h, 86\n-conversions.h, 43\n+conversions.h, 46\n DC1394_BASLER_SFF_TEST_IMAGES\n dc1394_deinterlace_stereo\n basler_sff.h, 86\n-conversions.h, 43\n+conversions.h, 46\n DC1394_BASLER_SFF_TRIGGER_FLAG_AND_COUNTER\n dc1394_deinterlace_stereo_frames\n basler_sff.h, 86\n-conversions.h, 44\n+conversions.h, 46\n dc1394_bayer_decoding_16bit\n dc1394_error_get_string\n-conversions.h, 42\n+conversions.h, 44\n utils.h, 66\n dc1394_bayer_decoding_8bit\n dc1394_external_trigger_get_mode\n \n Generated by Doxygen\n \n \fINDEX\n \n-control.h, 33\n+control.h, 35\n dc1394_external_trigger_get_polarity\n-control.h, 33\n+control.h, 35\n dc1394_external_trigger_get_power\n-control.h, 33\n+control.h, 36\n dc1394_external_trigger_get_source\n-control.h, 33\n+control.h, 36\n dc1394_external_trigger_get_supported_sources\n-control.h, 33\n+control.h, 36\n dc1394_external_trigger_has_polarity\n-control.h, 33\n+control.h, 36\n dc1394_external_trigger_set_mode\n-control.h, 34\n+control.h, 36\n dc1394_external_trigger_set_polarity\n-control.h, 34\n+control.h, 36\n dc1394_external_trigger_set_power\n-control.h, 34\n+control.h, 37\n dc1394_external_trigger_set_source\n-control.h, 34\n+control.h, 37\n dc1394_feature_get\n-control.h, 34\n+control.h, 37\n dc1394_feature_get_absolute_boundaries\n-control.h, 34\n+control.h, 37\n dc1394_feature_get_absolute_control\n-control.h, 35\n+control.h, 37\n dc1394_feature_get_absolute_value\n-control.h, 35\n+control.h, 37\n dc1394_feature_get_all\n-control.h, 35\n+control.h, 38\n dc1394_feature_get_boundaries\n-control.h, 35\n+control.h, 38\n dc1394_feature_get_mode\n-control.h, 35\n+control.h, 38\n dc1394_feature_get_modes\n-control.h, 36\n+control.h, 38\n dc1394_feature_get_power\n-control.h, 36\n+control.h, 38\n dc1394_feature_get_string\n utils.h, 66\n dc1394_feature_get_value\n-control.h, 36\n+control.h, 38\n dc1394_feature_has_absolute_control\n-control.h, 36\n+control.h, 39\n dc1394_feature_is_present\n-control.h, 36\n+control.h, 39\n dc1394_feature_is_readable\n-control.h, 36\n+control.h, 39\n dc1394_feature_is_switchable\n-control.h, 37\n+control.h, 39\n dc1394_feature_print\n-control.h, 37\n+control.h, 39\n dc1394_feature_print_all\n-control.h, 37\n+control.h, 39\n dc1394_feature_set_absolute_control\n-control.h, 37\n+control.h, 40\n dc1394_feature_set_absolute_value\n-control.h, 37\n+control.h, 40\n dc1394_feature_set_mode\n \n Generated by Doxygen\n \n 101\n \n-control.h, 37\n+control.h, 40\n dc1394_feature_set_power\n-control.h, 38\n+control.h, 40\n dc1394_feature_set_value\n-control.h, 38\n+control.h, 40\n dc1394_feature_temperature_get_value\n-control.h, 38\n+control.h, 40\n dc1394_feature_temperature_set_value\n-control.h, 38\n+control.h, 41\n dc1394_feature_whitebalance_get_value\n-control.h, 38\n+control.h, 41\n dc1394_feature_whitebalance_set_value\n-control.h, 38\n+control.h, 41\n dc1394_feature_whiteshading_get_value\n-control.h, 39\n+control.h, 41\n dc1394_feature_whiteshading_set_value\n-control.h, 39\n+control.h, 41\n dc1394_format7_get_color_coding\n-format7.h, 46\n+format7.h, 49\n dc1394_format7_get_color_codings\n-format7.h, 46\n+format7.h, 49\n dc1394_format7_get_color_filter\n-format7.h, 46\n+format7.h, 49\n dc1394_format7_get_data_depth\n-format7.h, 47\n+format7.h, 49\n dc1394_format7_get_frame_interval\n-format7.h, 47\n+format7.h, 50\n dc1394_format7_get_image_position\n-format7.h, 47\n+format7.h, 50\n dc1394_format7_get_image_size\n-format7.h, 47\n+format7.h, 50\n dc1394_format7_get_max_image_size\n-format7.h, 47\n+format7.h, 50\n dc1394_format7_get_mode_info\n-format7.h, 48\n+format7.h, 50\n dc1394_format7_get_modeset\n-format7.h, 48\n+format7.h, 51\n dc1394_format7_get_packet_parameters\n-format7.h, 48\n+format7.h, 51\n dc1394_format7_get_packet_size\n-format7.h, 48\n+format7.h, 51\n dc1394_format7_get_packets_per_frame\n-format7.h, 48\n+format7.h, 51\n dc1394_format7_get_pixel_number\n-format7.h, 49\n+format7.h, 51\n dc1394_format7_get_recommended_packet_size\n-format7.h, 49\n+format7.h, 52\n dc1394_format7_get_roi\n-format7.h, 49\n+format7.h, 52\n dc1394_format7_get_total_bytes\n-format7.h, 49\n+format7.h, 52\n dc1394_format7_get_unit_position\n-format7.h, 49\n+format7.h, 52\n dc1394_format7_get_unit_size\n-format7.h, 50\n+format7.h, 52\n dc1394_format7_set_color_coding\n-format7.h, 50\n+format7.h, 53\n dc1394_format7_set_image_position\n \n \f102\n \n-format7.h, 50\n+format7.h, 53\n dc1394_format7_set_image_size\n-format7.h, 50\n+format7.h, 53\n dc1394_format7_set_packet_size\n-format7.h, 50\n+format7.h, 53\n dc1394_format7_set_roi\n-format7.h, 51\n+format7.h, 53\n dc1394_framerate_as_float\n utils.h, 67\n dc1394_free\n camera.h, 28\n dc1394_get_absolute_register\n register.h, 61\n dc1394_get_adv_control_registers\n@@ -8511,50 +8512,50 @@\n dc1394_is_same_camera\n utils.h, 68\n dc1394_is_video_mode_scalable\n utils.h, 68\n dc1394_is_video_mode_still_image\n utils.h, 68\n dc1394_iso_allocate_bandwidth\n-iso.h, 52\n+iso.h, 54\n dc1394_iso_allocate_channel\n-iso.h, 52\n+iso.h, 55\n dc1394_iso_release_all\n-iso.h, 53\n+iso.h, 55\n dc1394_iso_release_bandwidth\n-iso.h, 53\n+iso.h, 56\n dc1394_iso_release_channel\n-iso.h, 54\n+iso.h, 56\n dc1394_iso_set_persist\n-iso.h, 54\n+iso.h, 57\n dc1394_log_debug\n log.h, 58\n dc1394_log_error\n \n INDEX\n \n log.h, 59\n dc1394_log_register_handler\n log.h, 59\n dc1394_log_set_default_handler\n log.h, 59\n dc1394_log_warning\n log.h, 59\n dc1394_memory_busy\n-control.h, 39\n+control.h, 42\n dc1394_memory_load\n-control.h, 39\n+control.h, 42\n dc1394_memory_save\n-control.h, 39\n+control.h, 42\n dc1394_new\n camera.h, 28\n dc1394_pio_get\n-control.h, 40\n+control.h, 42\n dc1394_pio_set\n-control.h, 40\n+control.h, 42\n dc1394_pxl_adv_feature_info_t\n pixelink.h, 88\n dc1394_pxl_camera_info_t\n pixelink.h, 88\n dc1394_pxl_convert_float32_to_quadlet\n pixelink.h, 89\n dc1394_pxl_convert_uint32_to_float32\n@@ -8599,17 +8600,17 @@\n dc1394_set_registers\n register.h, 63\n dc1394_set_SIO_register\n register.h, 63\n dc1394_set_strobe_register\n register.h, 63\n dc1394_software_trigger_get_power\n-control.h, 40\n+control.h, 42\n dc1394_software_trigger_set_power\n-control.h, 40\n+control.h, 43\n dc1394_video_get_bandwidth_usage\n video.h, 93\n dc1394_video_get_data_depth\n video.h, 93\n dc1394_video_get_framerate\n video.h, 93\n dc1394_video_get_iso_channel\n@@ -8667,48 +8668,48 @@\n dc1394basler_sff_feature_t\n basler_sff.h, 84, 85\n dc1394basler_sff_frame_counter_t, 10\n basler_sff.h, 85\n dc1394basler_sff_guid_t, 10\n dc1394basler_sff_t, 11\n dc1394bayer_method_t\n-conversions.h, 41\n+conversions.h, 44\n dc1394bool_t\n types.h, 64\n dc1394byte_order_t\n types.h, 64\n dc1394camera_id_t, 11\n dc1394camera_list_t\n camera.h, 26\n dc1394camera_t\n camera.h, 26\n dc1394capture_callback_t\n-capture.h, 56\n+capture.h, 30\n dc1394capture_policy_t\n-capture.h, 56\n+capture.h, 30\n dc1394color_coding_t\n types.h, 65\n dc1394color_codings_t, 11\n dc1394color_filter_t\n types.h, 65\n dc1394error_t\n log.h, 58\n dc1394feature_info_t\n-control.h, 31\n+control.h, 34\n dc1394feature_mode_t\n-control.h, 32\n+control.h, 34\n dc1394feature_modes_t, 12\n dc1394feature_t\n-control.h, 32\n+control.h, 34\n dc1394featureset_t\n-control.h, 31\n+control.h, 34\n dc1394format7mode_t\n-format7.h, 46\n+format7.h, 49\n dc1394format7modeset_t\n-format7.h, 46\n+format7.h, 49\n dc1394framerate_t\n video.h, 92\n dc1394framerates_t, 12\n dc1394iidc_version_t\n camera.h, 26\n dc1394log_t\n log.h, 58\n@@ -8724,58 +8725,58 @@\n dc1394pxl_gpio_mode_t\n pixelink.h, 88\n dc1394pxl_gpio_polarity_t\n pixelink.h, 88\n dc1394speed_t\n video.h, 93\n dc1394stereo_method_t\n-conversions.h, 41\n+conversions.h, 44\n dc1394switch_t\n types.h, 65\n dc1394trigger_mode_t\n-control.h, 32\n+control.h, 34\n dc1394trigger_modes_t, 12\n dc1394trigger_polarity_t\n-control.h, 32\n+control.h, 35\n dc1394trigger_source_t\n-control.h, 32\n+control.h, 35\n dc1394trigger_sources_t, 13\n dc1394video_frame_t\n video.h, 92\n dc1394video_mode_t\n types.h, 65\n dc1394video_modes_t, 13\n format7.h\n-dc1394_format7_get_color_coding, 46\n-dc1394_format7_get_color_codings, 46\n-dc1394_format7_get_color_filter, 46\n-dc1394_format7_get_data_depth, 47\n-dc1394_format7_get_frame_interval, 47\n-dc1394_format7_get_image_position, 47\n-dc1394_format7_get_image_size, 47\n-dc1394_format7_get_max_image_size, 47\n-dc1394_format7_get_mode_info, 48\n-dc1394_format7_get_modeset, 48\n-dc1394_format7_get_packet_parameters, 48\n-dc1394_format7_get_packet_size, 48\n-dc1394_format7_get_packets_per_frame, 48\n-dc1394_format7_get_pixel_number, 49\n+dc1394_format7_get_color_coding, 49\n+dc1394_format7_get_color_codings, 49\n+dc1394_format7_get_color_filter, 49\n+dc1394_format7_get_data_depth, 49\n+dc1394_format7_get_frame_interval, 50\n+dc1394_format7_get_image_position, 50\n+dc1394_format7_get_image_size, 50\n+dc1394_format7_get_max_image_size, 50\n+dc1394_format7_get_mode_info, 50\n+dc1394_format7_get_modeset, 51\n+dc1394_format7_get_packet_parameters, 51\n+dc1394_format7_get_packet_size, 51\n+dc1394_format7_get_packets_per_frame, 51\n+dc1394_format7_get_pixel_number, 51\n dc1394_format7_get_recommended_packet_size,\n-49\n-dc1394_format7_get_roi, 49\n-dc1394_format7_get_total_bytes, 49\n-dc1394_format7_get_unit_position, 49\n-dc1394_format7_get_unit_size, 50\n-dc1394_format7_set_color_coding, 50\n-dc1394_format7_set_image_position, 50\n-dc1394_format7_set_image_size, 50\n-dc1394_format7_set_packet_size, 50\n-dc1394_format7_set_roi, 51\n-dc1394format7mode_t, 46\n-dc1394format7modeset_t, 46\n+52\n+dc1394_format7_get_roi, 52\n+dc1394_format7_get_total_bytes, 52\n+dc1394_format7_get_unit_position, 52\n+dc1394_format7_get_unit_size, 52\n+dc1394_format7_set_color_coding, 53\n+dc1394_format7_set_image_position, 53\n+dc1394_format7_set_image_size, 53\n+dc1394_format7_set_packet_size, 53\n+dc1394_format7_set_roi, 53\n+dc1394format7mode_t, 49\n+dc1394format7modeset_t, 49\n fw_cdev_add_descriptor, 13\n fw_cdev_allocate, 14\n fw_cdev_allocate_iso_resource, 14\n fw_cdev_create_iso_context, 15\n fw_cdev_deallocate, 15\n \n INDEX\n@@ -8796,20 +8797,20 @@\n fw_cdev_remove_descriptor, 22\n fw_cdev_send_request, 22\n fw_cdev_send_response, 22\n fw_cdev_send_stream_packet, 23\n fw_cdev_start_iso, 23\n fw_cdev_stop_iso, 24\n iso.h\n-dc1394_iso_allocate_bandwidth, 52\n-dc1394_iso_allocate_channel, 52\n-dc1394_iso_release_all, 53\n-dc1394_iso_release_bandwidth, 53\n-dc1394_iso_release_channel, 54\n-dc1394_iso_set_persist, 54\n+dc1394_iso_allocate_bandwidth, 54\n+dc1394_iso_allocate_channel, 55\n+dc1394_iso_release_all, 55\n+dc1394_iso_release_bandwidth, 56\n+dc1394_iso_release_channel, 56\n+dc1394_iso_set_persist, 57\n log.h\n dc1394_log_debug, 58\n dc1394_log_error, 59\n dc1394_log_register_handler, 59\n dc1394_log_set_default_handler, 59\n dc1394_log_warning, 59\n dc1394error_t, 58\n"}]}]}]}]}]}]}